C44H34N8 — CID 135431066
2-[10,15,20-tris(2-aminophenyl)-21,23-dihydroporphyrin-5-yl]aniline (PubChem CID 135431066) has the molecular formula C44H34N8 and a molecular weight of 674.81 g/mol. Its IUPAC name is 2-[10,15,20-tris(2-aminophenyl)-21,23-dihydroporphyrin-5-yl]aniline.
| Compound Name | 2-[10,15,20-tris(2-aminophenyl)-21,23-dihydroporphyrin-5-yl]aniline |
|---|---|
| PubChem CID | 135431066 |
| Molecular Formula | C44H34N8 |
| Molecular Weight | 674.81 g/mol |
| Exact Mass | 674.29 |
| IUPAC Name | 2-[10,15,20-tris(2-aminophenyl)-21,23-dihydroporphyrin-5-yl]aniline |
| SMILES | Nc1ccccc1-c1c2nc(c(-c3ccccc3N)c3ccc([nH]3)c(-c3ccccc3N)c3nc(c(-c4ccccc4N)c4ccc1[nH]4)C=C3)C=C2 |
| InChI | InChI=1S/C44H34N8/c45-29-13-5-1-9-25(29)41-33-17-19-35(49-33)42(26-10-2-6-14-30(26)46)37-21-23-39(51-37)44(28-12-4-8-16-32(28)48)40-24-22-38(52-40)43(36-20-18-34(41)50-36)27-11-3-7-15-31(27)47/h1-24,49,52H,45-48H2/b41-33-,41-34-,42-35-,42-37-,43-36-,43-38-,44-39-,44-40- |
| InChIKey | FDJUBNCEVCSIAV-LWQDQPMZSA-N |
| XLogP | 9.65 |
| TPSA | 161.44 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 52 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 674.81 |
| LogP ≤ 5 | 9.65 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|