About 2-(4,7-dimethylquinazolin-2-yl)-1-[1-(4-hydroxy-2-oxopyran-3-yl)ethylidene]guanidine
2-(4,7-dimethylquinazolin-2-yl)-1-[1-(4-hydroxy-2-oxopyran-3-yl)ethylidene]guanidine (PubChem CID 135431138) has the molecular formula C18H17N5O3
and a molecular weight of 351.37 g/mol. Its IUPAC name is 2-(4,7-dimethylquinazolin-2-yl)-1-[1-(4-hydroxy-2-oxopyran-3-yl)ethylidene]guanidine.
Molecular Properties
| Compound Name | 2-(4,7-dimethylquinazolin-2-yl)-1-[1-(4-hydroxy-2-oxopyran-3-yl)ethylidene]guanidine |
| PubChem CID | 135431138 |
| Molecular Formula | C18H17N5O3 |
| Molecular Weight | 351.37 g/mol |
| Exact Mass | 351.13 |
| IUPAC Name | 2-(4,7-dimethylquinazolin-2-yl)-1-[1-(4-hydroxy-2-oxopyran-3-yl)ethylidene]guanidine |
| SMILES | CC(=NC(N)=Nc1nc(C)c2ccc(C)cc2n1)c1c(O)ccoc1=O |
| InChI | InChI=1S/C18H17N5O3/c1-9-4-5-12-10(2)21-18(22-13(12)8-9)23-17(19)20-11(3)15-14(24)6-7-26-16(15)25/h4-8,24H,1-3H3,(H2,19,21,22,23) |
| InChIKey | SPOXWUIAMLTYIF-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 126.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 351.37 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 2-(4,7-dimethylquinazolin-2-yl)-1-[1-(4-hydroxy-2-oxopyran-3-yl)ethylidene]guanidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4,7-dimethylquinazolin-2-yl)-1-[1-(4-hydroxy-2-oxopyran-3-yl)ethylidene]guanidine?
The IUPAC name of 2-(4,7-dimethylquinazolin-2-yl)-1-[1-(4-hydroxy-2-oxopyran-3-yl)ethylidene]guanidine (CID 135431138) is 2-(4,7-dimethylquinazolin-2-yl)-1-[1-(4-hydroxy-2-oxopyran-3-yl)ethylidene]guanidine.
What is the SMILES notation for 2-(4,7-dimethylquinazolin-2-yl)-1-[1-(4-hydroxy-2-oxopyran-3-yl)ethylidene]guanidine?
The canonical SMILES for 2-(4,7-dimethylquinazolin-2-yl)-1-[1-(4-hydroxy-2-oxopyran-3-yl)ethylidene]guanidine is CC(=NC(N)=Nc1nc(C)c2ccc(C)cc2n1)c1c(O)ccoc1=O.
What is the InChIKey of 2-(4,7-dimethylquinazolin-2-yl)-1-[1-(4-hydroxy-2-oxopyran-3-yl)ethylidene]guanidine?
The InChIKey is SPOXWUIAMLTYIF-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H17N5O3/c1-9-4-5-12-10(2)21-18(22-13(12)8-9)23-17(19)20-11(3)15-14(24)6-7-26-16(15)25/h4-8,24H,1-3H3,(H2,19,21,22,23).
What are the key properties of 2-(4,7-dimethylquinazolin-2-yl)-1-[1-(4-hydroxy-2-oxopyran-3-yl)ethylidene]guanidine?
2-(4,7-dimethylquinazolin-2-yl)-1-[1-(4-hydroxy-2-oxopyran-3-yl)ethylidene]guanidine has a molecular weight of 351.37 g/mol, XLogP of 2.36, 2 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4,7-dimethylquinazolin-2-yl)-1-[1-(4-hydroxy-2-oxopyran-3-yl)ethylidene]guanidine is sourced from PubChem (CID 135431138), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).