C7H8N2O — CID 135431340
3,5,6,7-tetrahydrocyclopenta[d]pyrimidin-4-one (PubChem CID 135431340) has the molecular formula C7H8N2O and a molecular weight of 136.15 g/mol. Its IUPAC name is 3,5,6,7-tetrahydrocyclopenta[d]pyrimidin-4-one.
| Compound Name | 3,5,6,7-tetrahydrocyclopenta[d]pyrimidin-4-one |
|---|---|
| PubChem CID | 135431340 |
| Molecular Formula | C7H8N2O |
| Molecular Weight | 136.15 g/mol |
| Exact Mass | 136.06 |
| IUPAC Name | 3,5,6,7-tetrahydrocyclopenta[d]pyrimidin-4-one |
| SMILES | O=c1[nH]cnc2c1CCC2 |
| InChI | InChI=1S/C7H8N2O/c10-7-5-2-1-3-6(5)8-4-9-7/h4H,1-3H2,(H,8,9,10) |
| InChIKey | RCTLNIIGJAMFQP-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 136.15 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |