C16H16N6O4S — CID 135431517
4-[(2,9-dioxo-1,4,5,6,7,8-hexahydropyrazolo[5,1-b]quinazolin-3-yl)diazenyl]benzenesulfonamide (PubChem CID 135431517) has the molecular formula C16H16N6O4S and a molecular weight of 388.41 g/mol. Its IUPAC name is 4-[(2,9-dioxo-1,4,5,6,7,8-hexahydropyrazolo[5,1-b]quinazolin-3-yl)diazenyl]benzenesulfonamide.
| Compound Name | 4-[(2,9-dioxo-1,4,5,6,7,8-hexahydropyrazolo[5,1-b]quinazolin-3-yl)diazenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 135431517 |
| Molecular Formula | C16H16N6O4S |
| Molecular Weight | 388.41 g/mol |
| Exact Mass | 388.10 |
| IUPAC Name | 4-[(2,9-dioxo-1,4,5,6,7,8-hexahydropyrazolo[5,1-b]quinazolin-3-yl)diazenyl]benzenesulfonamide |
| SMILES | NS(=O)(=O)c1ccc(/N=N/c2c(=O)[nH]n3c(=O)c4c([nH]c23)CCCC4)cc1 |
| InChI | InChI=1S/C16H16N6O4S/c17-27(25,26)10-7-5-9(6-8-10)19-20-13-14-18-12-4-2-1-3-11(12)16(24)22(14)21-15(13)23/h5-8,18H,1-4H2,(H,21,23)(H2,17,25,26)/b20-19+ |
| InChIKey | QAIGSHPWDVHVGF-FMQUCBEESA-N |
| XLogP | 1.26 |
| TPSA | 155.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.41 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|