C13H11N5O2 — CID 135431525
5-methyl-3-phenyldiazenyl-1,4-dihydropyrazolo[1,5-a]pyrimidine-2,7-dione (PubChem CID 135431525) has the molecular formula C13H11N5O2 and a molecular weight of 269.26 g/mol. Its IUPAC name is 5-methyl-3-phenyldiazenyl-1,4-dihydropyrazolo[1,5-a]pyrimidine-2,7-dione.
| Compound Name | 5-methyl-3-phenyldiazenyl-1,4-dihydropyrazolo[1,5-a]pyrimidine-2,7-dione |
|---|---|
| PubChem CID | 135431525 |
| Molecular Formula | C13H11N5O2 |
| Molecular Weight | 269.26 g/mol |
| Exact Mass | 269.09 |
| IUPAC Name | 5-methyl-3-phenyldiazenyl-1,4-dihydropyrazolo[1,5-a]pyrimidine-2,7-dione |
| SMILES | Cc1cc(=O)n2[nH]c(=O)c(/N=N/c3ccccc3)c2[nH]1 |
| InChI | InChI=1S/C13H11N5O2/c1-8-7-10(19)18-12(14-8)11(13(20)17-18)16-15-9-5-3-2-4-6-9/h2-7,14H,1H3,(H,17,20)/b16-15+ |
| InChIKey | DELDPUNTSBPABY-FOCLMDBBSA-N |
| XLogP | 2.04 |
| TPSA | 94.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.26 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|