C14H13N5O2 — CID 135431526
5-methyl-3-[(4-methylphenyl)diazenyl]-1,4-dihydropyrazolo[1,5-a]pyrimidine-2,7-dione (PubChem CID 135431526) has the molecular formula C14H13N5O2 and a molecular weight of 283.29 g/mol. Its IUPAC name is 5-methyl-3-[(4-methylphenyl)diazenyl]-1,4-dihydropyrazolo[1,5-a]pyrimidine-2,7-dione.
| Compound Name | 5-methyl-3-[(4-methylphenyl)diazenyl]-1,4-dihydropyrazolo[1,5-a]pyrimidine-2,7-dione |
|---|---|
| PubChem CID | 135431526 |
| Molecular Formula | C14H13N5O2 |
| Molecular Weight | 283.29 g/mol |
| Exact Mass | 283.11 |
| IUPAC Name | 5-methyl-3-[(4-methylphenyl)diazenyl]-1,4-dihydropyrazolo[1,5-a]pyrimidine-2,7-dione |
| SMILES | Cc1ccc(/N=N/c2c(=O)[nH]n3c(=O)cc(C)[nH]c23)cc1 |
| InChI | InChI=1S/C14H13N5O2/c1-8-3-5-10(6-4-8)16-17-12-13-15-9(2)7-11(20)19(13)18-14(12)21/h3-7,15H,1-2H3,(H,18,21)/b17-16+ |
| InChIKey | OXPIXGHCQPZWMJ-WUKNDPDISA-N |
| XLogP | 2.35 |
| TPSA | 94.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.29 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|