About 3-hydroxy-5,5-dimethyl-2-(pyridin-3-yliminomethyl)cyclohex-2-en-1-one
3-hydroxy-5,5-dimethyl-2-(pyridin-3-yliminomethyl)cyclohex-2-en-1-one (PubChem CID 135431860) has the molecular formula C14H16N2O2
and a molecular weight of 244.29 g/mol. Its IUPAC name is 3-hydroxy-5,5-dimethyl-2-(pyridin-3-yliminomethyl)cyclohex-2-en-1-one.
Molecular Properties
| Compound Name | 3-hydroxy-5,5-dimethyl-2-(pyridin-3-yliminomethyl)cyclohex-2-en-1-one |
| PubChem CID | 135431860 |
| Molecular Formula | C14H16N2O2 |
| Molecular Weight | 244.29 g/mol |
| Exact Mass | 244.12 |
| IUPAC Name | 3-hydroxy-5,5-dimethyl-2-(pyridin-3-yliminomethyl)cyclohex-2-en-1-one |
| SMILES | CC1(C)CC(=O)C(/C=N/c2cccnc2)=C(O)C1 |
| InChI | InChI=1S/C14H16N2O2/c1-14(2)6-12(17)11(13(18)7-14)9-16-10-4-3-5-15-8-10/h3-5,8-9,17H,6-7H2,1-2H3/b16-9+ |
| InChIKey | UEZBXOIMUIFXPN-CXUHLZMHSA-N |
| XLogP | 2.99 |
| TPSA | 62.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.29 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 3-hydroxy-5,5-dimethyl-2-(pyridin-3-yliminomethyl)cyclohex-2-en-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-hydroxy-5,5-dimethyl-2-(pyridin-3-yliminomethyl)cyclohex-2-en-1-one?
The IUPAC name of 3-hydroxy-5,5-dimethyl-2-(pyridin-3-yliminomethyl)cyclohex-2-en-1-one (CID 135431860) is 3-hydroxy-5,5-dimethyl-2-(pyridin-3-yliminomethyl)cyclohex-2-en-1-one.
What is the SMILES notation for 3-hydroxy-5,5-dimethyl-2-(pyridin-3-yliminomethyl)cyclohex-2-en-1-one?
The canonical SMILES for 3-hydroxy-5,5-dimethyl-2-(pyridin-3-yliminomethyl)cyclohex-2-en-1-one is CC1(C)CC(=O)C(/C=N/c2cccnc2)=C(O)C1.
What is the InChIKey of 3-hydroxy-5,5-dimethyl-2-(pyridin-3-yliminomethyl)cyclohex-2-en-1-one?
The InChIKey is UEZBXOIMUIFXPN-CXUHLZMHSA-N. The full InChI is InChI=1S/C14H16N2O2/c1-14(2)6-12(17)11(13(18)7-14)9-16-10-4-3-5-15-8-10/h3-5,8-9,17H,6-7H2,1-2H3/b16-9+.
What are the key properties of 3-hydroxy-5,5-dimethyl-2-(pyridin-3-yliminomethyl)cyclohex-2-en-1-one?
3-hydroxy-5,5-dimethyl-2-(pyridin-3-yliminomethyl)cyclohex-2-en-1-one has a molecular weight of 244.29 g/mol, XLogP of 2.99, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-hydroxy-5,5-dimethyl-2-(pyridin-3-yliminomethyl)cyclohex-2-en-1-one is sourced from PubChem (CID 135431860), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).