C12H12N4O — CID 135432076
2-amino-6-phenyl-5,7-dihydro-3H-pyrrolo[3,4-d]pyrimidin-4-one (PubChem CID 135432076) has the molecular formula C12H12N4O and a molecular weight of 228.26 g/mol. Its IUPAC name is 2-amino-6-phenyl-5,7-dihydro-3H-pyrrolo[3,4-d]pyrimidin-4-one.
| Compound Name | 2-amino-6-phenyl-5,7-dihydro-3H-pyrrolo[3,4-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 135432076 |
| Molecular Formula | C12H12N4O |
| Molecular Weight | 228.26 g/mol |
| Exact Mass | 228.10 |
| IUPAC Name | 2-amino-6-phenyl-5,7-dihydro-3H-pyrrolo[3,4-d]pyrimidin-4-one |
| SMILES | Nc1nc2c(c(=O)[nH]1)CN(c1ccccc1)C2 |
| InChI | InChI=1S/C12H12N4O/c13-12-14-10-7-16(6-9(10)11(17)15-12)8-4-2-1-3-5-8/h1-5H,6-7H2,(H3,13,14,15,17) |
| InChIKey | QRAGRBGCQQOIHM-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 75.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.26 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |