C34H36N4O5 — CID 135432117
methyl 3-[(8Z)-8-(1-hydroxyethylidene)-18-(3-methoxy-3-oxopropyl)-3,7,12,17-tetramethyl-23H-porphyrin-2-yl]propanoate (PubChem CID 135432117) has the molecular formula C34H36N4O5 and a molecular weight of 580.69 g/mol. Its IUPAC name is methyl 3-[(8Z)-8-(1-hydroxyethylidene)-18-(3-methoxy-3-oxopropyl)-3,7,12,17-tetramethyl-23H-porphyrin-2-yl]propanoate.
| Compound Name | methyl 3-[(8Z)-8-(1-hydroxyethylidene)-18-(3-methoxy-3-oxopropyl)-3,7,12,17-tetramethyl-23H-porphyrin-2-yl]propanoate |
|---|---|
| PubChem CID | 135432117 |
| Molecular Formula | C34H36N4O5 |
| Molecular Weight | 580.69 g/mol |
| Exact Mass | 580.27 |
| IUPAC Name | methyl 3-[(8Z)-8-(1-hydroxyethylidene)-18-(3-methoxy-3-oxopropyl)-3,7,12,17-tetramethyl-23H-porphyrin-2-yl]propanoate |
| SMILES | COC(=O)CCC1=C(C)/C2=C/C3=C(C)/C(=C(\C)O)C(=N3)/C=c3\[nH]/c(cc3C)=C\C3=N/C(=C\C1=N2)C(CCC(=O)OC)=C3C |
| InChI | InChI=1S/C34H36N4O5/c1-17-12-22-13-26-18(2)23(8-10-32(40)42-6)29(36-26)16-30-24(9-11-33(41)43-7)19(3)27(37-30)15-28-20(4)34(21(5)39)31(38-28)14-25(17)35-22/h12-16,35,39H,8-11H2,1-7H3/b22-13-,25-14-,27-15-,29-16-,34-21- |
| InChIKey | ITVYLHUTMOMRCT-YZVIBWOHSA-N |
| XLogP | 4.67 |
| TPSA | 125.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.69 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|