About 2-[(E)-2-(3,4-dihydroxyphenyl)ethenyl]quinoline-6-carboxylic acid
2-[(E)-2-(3,4-dihydroxyphenyl)ethenyl]quinoline-6-carboxylic acid (PubChem CID 135432892) has the molecular formula C18H13NO4
and a molecular weight of 307.31 g/mol. Its IUPAC name is 2-[(E)-2-(3,4-dihydroxyphenyl)ethenyl]quinoline-6-carboxylic acid.
Molecular Properties
| Compound Name | 2-[(E)-2-(3,4-dihydroxyphenyl)ethenyl]quinoline-6-carboxylic acid |
| PubChem CID | 135432892 |
| Molecular Formula | C18H13NO4 |
| Molecular Weight | 307.31 g/mol |
| Exact Mass | 307.08 |
| IUPAC Name | 2-[(E)-2-(3,4-dihydroxyphenyl)ethenyl]quinoline-6-carboxylic acid |
| SMILES | O=C(O)c1ccc2nc(/C=C/c3ccc(O)c(O)c3)ccc2c1 |
| InChI | InChI=1S/C18H13NO4/c20-16-8-2-11(9-17(16)21)1-5-14-6-3-12-10-13(18(22)23)4-7-15(12)19-14/h1-10,20-21H,(H,22,23)/b5-1+ |
| InChIKey | SGCGDTZRELNLOP-ORCRQEGFSA-N |
| XLogP | 3.51 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 307.31 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|
Analyze 2-[(E)-2-(3,4-dihydroxyphenyl)ethenyl]quinoline-6-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(E)-2-(3,4-dihydroxyphenyl)ethenyl]quinoline-6-carboxylic acid?
The IUPAC name of 2-[(E)-2-(3,4-dihydroxyphenyl)ethenyl]quinoline-6-carboxylic acid (CID 135432892) is 2-[(E)-2-(3,4-dihydroxyphenyl)ethenyl]quinoline-6-carboxylic acid.
What is the SMILES notation for 2-[(E)-2-(3,4-dihydroxyphenyl)ethenyl]quinoline-6-carboxylic acid?
The canonical SMILES for 2-[(E)-2-(3,4-dihydroxyphenyl)ethenyl]quinoline-6-carboxylic acid is O=C(O)c1ccc2nc(/C=C/c3ccc(O)c(O)c3)ccc2c1.
What is the InChIKey of 2-[(E)-2-(3,4-dihydroxyphenyl)ethenyl]quinoline-6-carboxylic acid?
The InChIKey is SGCGDTZRELNLOP-ORCRQEGFSA-N. The full InChI is InChI=1S/C18H13NO4/c20-16-8-2-11(9-17(16)21)1-5-14-6-3-12-10-13(18(22)23)4-7-15(12)19-14/h1-10,20-21H,(H,22,23)/b5-1+.
What are the key properties of 2-[(E)-2-(3,4-dihydroxyphenyl)ethenyl]quinoline-6-carboxylic acid?
2-[(E)-2-(3,4-dihydroxyphenyl)ethenyl]quinoline-6-carboxylic acid has a molecular weight of 307.31 g/mol, XLogP of 3.51, 3 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(E)-2-(3,4-dihydroxyphenyl)ethenyl]quinoline-6-carboxylic acid is sourced from PubChem (CID 135432892), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).