C19H22N4O3 — CID 135432989
(NE)-N-[1-[7-(2,4-dimethoxyphenyl)-2,5-dimethylpyrrolo[2,3-d]pyrimidin-4-yl]propylidene]hydroxylamine (PubChem CID 135432989) has the molecular formula C19H22N4O3 and a molecular weight of 354.41 g/mol. Its IUPAC name is (NE)-N-[1-[7-(2,4-dimethoxyphenyl)-2,5-dimethylpyrrolo[2,3-d]pyrimidin-4-yl]propylidene]hydroxylamine.
| Compound Name | (NE)-N-[1-[7-(2,4-dimethoxyphenyl)-2,5-dimethylpyrrolo[2,3-d]pyrimidin-4-yl]propylidene]hydroxylamine |
|---|---|
| PubChem CID | 135432989 |
| Molecular Formula | C19H22N4O3 |
| Molecular Weight | 354.41 g/mol |
| Exact Mass | 354.17 |
| IUPAC Name | (NE)-N-[1-[7-(2,4-dimethoxyphenyl)-2,5-dimethylpyrrolo[2,3-d]pyrimidin-4-yl]propylidene]hydroxylamine |
| SMILES | CC/C(=N\O)c1nc(C)nc2c1c(C)cn2-c1ccc(OC)cc1OC |
| InChI | InChI=1S/C19H22N4O3/c1-6-14(22-24)18-17-11(2)10-23(19(17)21-12(3)20-18)15-8-7-13(25-4)9-16(15)26-5/h7-10,24H,6H2,1-5H3/b22-14+ |
| InChIKey | NFBKANMQZJMLQF-HYARGMPZSA-N |
| XLogP | 3.64 |
| TPSA | 81.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.41 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|