About 4-[3-(1H-benzimidazol-2-yl)-1H-indazol-5-yl]-3,5-difluorophenol
4-[3-(1H-benzimidazol-2-yl)-1H-indazol-5-yl]-3,5-difluorophenol (PubChem CID 135433004) has the molecular formula C20H12F2N4O
and a molecular weight of 362.34 g/mol. Its IUPAC name is 4-[3-(1H-benzimidazol-2-yl)-1H-indazol-5-yl]-3,5-difluorophenol.
Molecular Properties
| Compound Name | 4-[3-(1H-benzimidazol-2-yl)-1H-indazol-5-yl]-3,5-difluorophenol |
| PubChem CID | 135433004 |
| Molecular Formula | C20H12F2N4O |
| Molecular Weight | 362.34 g/mol |
| Exact Mass | 362.10 |
| IUPAC Name | 4-[3-(1H-benzimidazol-2-yl)-1H-indazol-5-yl]-3,5-difluorophenol |
| SMILES | Oc1cc(F)c(-c2ccc3[nH]nc(-c4nc5ccccc5[nH]4)c3c2)c(F)c1 |
| InChI | InChI=1S/C20H12F2N4O/c21-13-8-11(27)9-14(22)18(13)10-5-6-15-12(7-10)19(26-25-15)20-23-16-3-1-2-4-17(16)24-20/h1-9,27H,(H,23,24)(H,25,26) |
| InChIKey | OZEABGPSSQAFFV-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 77.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 362.34 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-[3-(1H-benzimidazol-2-yl)-1H-indazol-5-yl]-3,5-difluorophenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[3-(1H-benzimidazol-2-yl)-1H-indazol-5-yl]-3,5-difluorophenol?
The IUPAC name of 4-[3-(1H-benzimidazol-2-yl)-1H-indazol-5-yl]-3,5-difluorophenol (CID 135433004) is 4-[3-(1H-benzimidazol-2-yl)-1H-indazol-5-yl]-3,5-difluorophenol.
What is the SMILES notation for 4-[3-(1H-benzimidazol-2-yl)-1H-indazol-5-yl]-3,5-difluorophenol?
The canonical SMILES for 4-[3-(1H-benzimidazol-2-yl)-1H-indazol-5-yl]-3,5-difluorophenol is Oc1cc(F)c(-c2ccc3[nH]nc(-c4nc5ccccc5[nH]4)c3c2)c(F)c1.
What is the InChIKey of 4-[3-(1H-benzimidazol-2-yl)-1H-indazol-5-yl]-3,5-difluorophenol?
The InChIKey is OZEABGPSSQAFFV-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H12F2N4O/c21-13-8-11(27)9-14(22)18(13)10-5-6-15-12(7-10)19(26-25-15)20-23-16-3-1-2-4-17(16)24-20/h1-9,27H,(H,23,24)(H,25,26).
What are the key properties of 4-[3-(1H-benzimidazol-2-yl)-1H-indazol-5-yl]-3,5-difluorophenol?
4-[3-(1H-benzimidazol-2-yl)-1H-indazol-5-yl]-3,5-difluorophenol has a molecular weight of 362.34 g/mol, XLogP of 4.76, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[3-(1H-benzimidazol-2-yl)-1H-indazol-5-yl]-3,5-difluorophenol is sourced from PubChem (CID 135433004), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).