C21H18O6 — CID 135433351
methyl 2-[15-[(Z)-2-hydroxyprop-1-enyl]-3-oxo-12,16-dioxatetracyclo[7.7.1.02,7.013,17]heptadeca-1,4,6,8,13(17),14-hexaen-11-yl]acetate (PubChem CID 135433351) has the molecular formula C21H18O6 and a molecular weight of 366.37 g/mol. Its IUPAC name is methyl 2-[15-[(Z)-2-hydroxyprop-1-enyl]-3-oxo-12,16-dioxatetracyclo[7.7.1.02,7.013,17]heptadeca-1,4,6,8,13(17),14-hexaen-11-yl]acetate.
| Compound Name | methyl 2-[15-[(Z)-2-hydroxyprop-1-enyl]-3-oxo-12,16-dioxatetracyclo[7.7.1.02,7.013,17]heptadeca-1,4,6,8,13(17),14-hexaen-11-yl]acetate |
|---|---|
| PubChem CID | 135433351 |
| Molecular Formula | C21H18O6 |
| Molecular Weight | 366.37 g/mol |
| Exact Mass | 366.11 |
| IUPAC Name | methyl 2-[15-[(Z)-2-hydroxyprop-1-enyl]-3-oxo-12,16-dioxatetracyclo[7.7.1.02,7.013,17]heptadeca-1,4,6,8,13(17),14-hexaen-11-yl]acetate |
| SMILES | COC(=O)CC1Cc2cc3cccc(=O)c3c3oc(/C=C(/C)O)cc(c23)O1 |
| InChI | InChI=1S/C21H18O6/c1-11(22)6-14-9-17-20-13(8-15(26-17)10-18(24)25-2)7-12-4-3-5-16(23)19(12)21(20)27-14/h3-7,9,15,22H,8,10H2,1-2H3/b11-6- |
| InChIKey | MCYNRYRDTKWZOE-WDZFZDKYSA-N |
| XLogP | 3.73 |
| TPSA | 85.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.37 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|