About 2-amino-5,7-dimethyl-3H-pyrrolo[2,3-d]pyrimidin-4-one
2-amino-5,7-dimethyl-3H-pyrrolo[2,3-d]pyrimidin-4-one (PubChem CID 135433729) has the molecular formula C8H10N4O
and a molecular weight of 178.19 g/mol. Its IUPAC name is 2-amino-5,7-dimethyl-3H-pyrrolo[2,3-d]pyrimidin-4-one.
Molecular Properties
| Compound Name | 2-amino-5,7-dimethyl-3H-pyrrolo[2,3-d]pyrimidin-4-one |
| PubChem CID | 135433729 |
| Molecular Formula | C8H10N4O |
| Molecular Weight | 178.19 g/mol |
| Exact Mass | 178.09 |
| IUPAC Name | 2-amino-5,7-dimethyl-3H-pyrrolo[2,3-d]pyrimidin-4-one |
| SMILES | Cc1cn(C)c2nc(N)[nH]c(=O)c12 |
| InChI | InChI=1S/C8H10N4O/c1-4-3-12(2)6-5(4)7(13)11-8(9)10-6/h3H,1-2H3,(H3,9,10,11,13) |
| InChIKey | PUXCXVAYUSPONY-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 76.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.19 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-amino-5,7-dimethyl-3H-pyrrolo[2,3-d]pyrimidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-5,7-dimethyl-3H-pyrrolo[2,3-d]pyrimidin-4-one?
The IUPAC name of 2-amino-5,7-dimethyl-3H-pyrrolo[2,3-d]pyrimidin-4-one (CID 135433729) is 2-amino-5,7-dimethyl-3H-pyrrolo[2,3-d]pyrimidin-4-one.
What is the SMILES notation for 2-amino-5,7-dimethyl-3H-pyrrolo[2,3-d]pyrimidin-4-one?
The canonical SMILES for 2-amino-5,7-dimethyl-3H-pyrrolo[2,3-d]pyrimidin-4-one is Cc1cn(C)c2nc(N)[nH]c(=O)c12.
What is the InChIKey of 2-amino-5,7-dimethyl-3H-pyrrolo[2,3-d]pyrimidin-4-one?
The InChIKey is PUXCXVAYUSPONY-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10N4O/c1-4-3-12(2)6-5(4)7(13)11-8(9)10-6/h3H,1-2H3,(H3,9,10,11,13).
What are the key properties of 2-amino-5,7-dimethyl-3H-pyrrolo[2,3-d]pyrimidin-4-one?
2-amino-5,7-dimethyl-3H-pyrrolo[2,3-d]pyrimidin-4-one has a molecular weight of 178.19 g/mol, XLogP of 0.15, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-5,7-dimethyl-3H-pyrrolo[2,3-d]pyrimidin-4-one is sourced from PubChem (CID 135433729), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).