About 2-chloro-7H-pyrimido[5,4-d]pyrimidin-8-one
2-chloro-7H-pyrimido[5,4-d]pyrimidin-8-one (PubChem CID 135433733) has the molecular formula C6H3ClN4O
and a molecular weight of 182.57 g/mol. Its IUPAC name is 2-chloro-7H-pyrimido[5,4-d]pyrimidin-8-one.
Molecular Properties
| Compound Name | 2-chloro-7H-pyrimido[5,4-d]pyrimidin-8-one |
| PubChem CID | 135433733 |
| Molecular Formula | C6H3ClN4O |
| Molecular Weight | 182.57 g/mol |
| Exact Mass | 182.00 |
| IUPAC Name | 2-chloro-7H-pyrimido[5,4-d]pyrimidin-8-one |
| SMILES | O=c1[nH]cnc2cnc(Cl)nc12 |
| InChI | InChI=1S/C6H3ClN4O/c7-6-8-1-3-4(11-6)5(12)10-2-9-3/h1-2H,(H,9,10,12) |
| InChIKey | OBLBJCVARYVWJH-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.57 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-chloro-7H-pyrimido[5,4-d]pyrimidin-8-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-7H-pyrimido[5,4-d]pyrimidin-8-one?
The IUPAC name of 2-chloro-7H-pyrimido[5,4-d]pyrimidin-8-one (CID 135433733) is 2-chloro-7H-pyrimido[5,4-d]pyrimidin-8-one.
What is the SMILES notation for 2-chloro-7H-pyrimido[5,4-d]pyrimidin-8-one?
The canonical SMILES for 2-chloro-7H-pyrimido[5,4-d]pyrimidin-8-one is O=c1[nH]cnc2cnc(Cl)nc12.
What is the InChIKey of 2-chloro-7H-pyrimido[5,4-d]pyrimidin-8-one?
The InChIKey is OBLBJCVARYVWJH-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H3ClN4O/c7-6-8-1-3-4(11-6)5(12)10-2-9-3/h1-2H,(H,9,10,12).
What are the key properties of 2-chloro-7H-pyrimido[5,4-d]pyrimidin-8-one?
2-chloro-7H-pyrimido[5,4-d]pyrimidin-8-one has a molecular weight of 182.57 g/mol, XLogP of 0.37, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-7H-pyrimido[5,4-d]pyrimidin-8-one is sourced from PubChem (CID 135433733), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).