C9H9N5O3S — CID 135433802
(NE)-N-(5-amino-3-imino-1,1-dioxo-2-phenyl-1,2,6-thiadiazin-4-ylidene)hydroxylamine (PubChem CID 135433802) has the molecular formula C9H9N5O3S and a molecular weight of 267.27 g/mol. Its IUPAC name is (NE)-N-(5-amino-3-imino-1,1-dioxo-2-phenyl-1,2,6-thiadiazin-4-ylidene)hydroxylamine.
| Compound Name | (NE)-N-(5-amino-3-imino-1,1-dioxo-2-phenyl-1,2,6-thiadiazin-4-ylidene)hydroxylamine |
|---|---|
| PubChem CID | 135433802 |
| Molecular Formula | C9H9N5O3S |
| Molecular Weight | 267.27 g/mol |
| Exact Mass | 267.04 |
| IUPAC Name | (NE)-N-(5-amino-3-imino-1,1-dioxo-2-phenyl-1,2,6-thiadiazin-4-ylidene)hydroxylamine |
| SMILES | [H]/N=C1C(=N\O)\C(N)=NS(=O)(=O)N\1c1ccccc1 |
| InChI | InChI=1S/C9H9N5O3S/c10-8-7(12-15)9(11)14(18(16,17)13-8)6-4-2-1-3-5-6/h1-5,11,15H,(H2,10,13)/b11-9+,12-7+ |
| InChIKey | ZGXNVZRJKUFMCB-DMXQEXBGSA-N |
| XLogP | -0.08 |
| TPSA | 132.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.27 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|