C14H12N4O3 — CID 135433836
N-(4-methoxyphenyl)-1,4-dioxido-1,2,4-benzotriazine-1,4-diium-3-amine (PubChem CID 135433836) has the molecular formula C14H12N4O3 and a molecular weight of 284.28 g/mol. Its IUPAC name is N-(4-methoxyphenyl)-1,4-dioxido-1,2,4-benzotriazine-1,4-diium-3-amine.
| Compound Name | N-(4-methoxyphenyl)-1,4-dioxido-1,2,4-benzotriazine-1,4-diium-3-amine |
|---|---|
| PubChem CID | 135433836 |
| Molecular Formula | C14H12N4O3 |
| Molecular Weight | 284.28 g/mol |
| Exact Mass | 284.09 |
| IUPAC Name | N-(4-methoxyphenyl)-1,4-dioxido-1,2,4-benzotriazine-1,4-diium-3-amine |
| SMILES | COc1ccc(Nc2n[n+]([O-])c3ccccc3[n+]2[O-])cc1 |
| InChI | InChI=1S/C14H12N4O3/c1-21-11-8-6-10(7-9-11)15-14-16-18(20)13-5-3-2-4-12(13)17(14)19/h2-9H,1H3,(H,15,16) |
| InChIKey | PDGGIKISRFLNDJ-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 88.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.28 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|