C20H19N5 — CID 135433924
5,15-dimethyl-13-phenyl-1,9,11,13,14-pentazatetracyclo[8.7.0.03,8.012,16]heptadeca-3(8),4,6,10,12(16),14-hexaene (PubChem CID 135433924) has the molecular formula C20H19N5 and a molecular weight of 329.41 g/mol. Its IUPAC name is 5,15-dimethyl-13-phenyl-1,9,11,13,14-pentazatetracyclo[8.7.0.03,8.012,16]heptadeca-3(8),4,6,10,12(16),14-hexaene.
| Compound Name | 5,15-dimethyl-13-phenyl-1,9,11,13,14-pentazatetracyclo[8.7.0.03,8.012,16]heptadeca-3(8),4,6,10,12(16),14-hexaene |
|---|---|
| PubChem CID | 135433924 |
| Molecular Formula | C20H19N5 |
| Molecular Weight | 329.41 g/mol |
| Exact Mass | 329.16 |
| IUPAC Name | 5,15-dimethyl-13-phenyl-1,9,11,13,14-pentazatetracyclo[8.7.0.03,8.012,16]heptadeca-3(8),4,6,10,12(16),14-hexaene |
| SMILES | Cc1ccc2c(c1)CN1Cc3c(C)nn(-c4ccccc4)c3N=C1N2 |
| InChI | InChI=1S/C20H19N5/c1-13-8-9-18-15(10-13)11-24-12-17-14(2)23-25(16-6-4-3-5-7-16)19(17)22-20(24)21-18/h3-10H,11-12H2,1-2H3,(H,21,22) |
| InChIKey | AYSKQYHPIKIYHZ-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 45.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.41 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |