About 5-[2-(3,4-dimethylanilino)pyrimidin-4-yl]-2-hydroxybenzamide
5-[2-(3,4-dimethylanilino)pyrimidin-4-yl]-2-hydroxybenzamide (PubChem CID 135433937) has the molecular formula C19H18N4O2
and a molecular weight of 334.38 g/mol. Its IUPAC name is 5-[2-(3,4-dimethylanilino)pyrimidin-4-yl]-2-hydroxybenzamide.
Molecular Properties
| Compound Name | 5-[2-(3,4-dimethylanilino)pyrimidin-4-yl]-2-hydroxybenzamide |
| PubChem CID | 135433937 |
| Molecular Formula | C19H18N4O2 |
| Molecular Weight | 334.38 g/mol |
| Exact Mass | 334.14 |
| IUPAC Name | 5-[2-(3,4-dimethylanilino)pyrimidin-4-yl]-2-hydroxybenzamide |
| SMILES | Cc1ccc(Nc2nccc(-c3ccc(O)c(C(N)=O)c3)n2)cc1C |
| InChI | InChI=1S/C19H18N4O2/c1-11-3-5-14(9-12(11)2)22-19-21-8-7-16(23-19)13-4-6-17(24)15(10-13)18(20)25/h3-10,24H,1-2H3,(H2,20,25)(H,21,22,23) |
| InChIKey | FGRYUTWEHPPKOX-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 101.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.38 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-[2-(3,4-dimethylanilino)pyrimidin-4-yl]-2-hydroxybenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[2-(3,4-dimethylanilino)pyrimidin-4-yl]-2-hydroxybenzamide?
The IUPAC name of 5-[2-(3,4-dimethylanilino)pyrimidin-4-yl]-2-hydroxybenzamide (CID 135433937) is 5-[2-(3,4-dimethylanilino)pyrimidin-4-yl]-2-hydroxybenzamide.
What is the SMILES notation for 5-[2-(3,4-dimethylanilino)pyrimidin-4-yl]-2-hydroxybenzamide?
The canonical SMILES for 5-[2-(3,4-dimethylanilino)pyrimidin-4-yl]-2-hydroxybenzamide is Cc1ccc(Nc2nccc(-c3ccc(O)c(C(N)=O)c3)n2)cc1C.
What is the InChIKey of 5-[2-(3,4-dimethylanilino)pyrimidin-4-yl]-2-hydroxybenzamide?
The InChIKey is FGRYUTWEHPPKOX-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H18N4O2/c1-11-3-5-14(9-12(11)2)22-19-21-8-7-16(23-19)13-4-6-17(24)15(10-13)18(20)25/h3-10,24H,1-2H3,(H2,20,25)(H,21,22,23).
What are the key properties of 5-[2-(3,4-dimethylanilino)pyrimidin-4-yl]-2-hydroxybenzamide?
5-[2-(3,4-dimethylanilino)pyrimidin-4-yl]-2-hydroxybenzamide has a molecular weight of 334.38 g/mol, XLogP of 3.31, 4 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[2-(3,4-dimethylanilino)pyrimidin-4-yl]-2-hydroxybenzamide is sourced from PubChem (CID 135433937), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).