C11H15N5O8 — CID 135433955
[2-amino-1-[hydroxyimino(oxido)azaniumyl]-2-oxo-1-(3,4,5-trimethoxyphenyl)ethyl]-hydroxyimino-oxidoazanium (PubChem CID 135433955) has the molecular formula C11H15N5O8 and a molecular weight of 345.27 g/mol. Its IUPAC name is [2-amino-1-[hydroxyimino(oxido)azaniumyl]-2-oxo-1-(3,4,5-trimethoxyphenyl)ethyl]-hydroxyimino-oxidoazanium.
| Compound Name | [2-amino-1-[hydroxyimino(oxido)azaniumyl]-2-oxo-1-(3,4,5-trimethoxyphenyl)ethyl]-hydroxyimino-oxidoazanium |
|---|---|
| PubChem CID | 135433955 |
| Molecular Formula | C11H15N5O8 |
| Molecular Weight | 345.27 g/mol |
| Exact Mass | 345.09 |
| IUPAC Name | [2-amino-1-[hydroxyimino(oxido)azaniumyl]-2-oxo-1-(3,4,5-trimethoxyphenyl)ethyl]-hydroxyimino-oxidoazanium |
| SMILES | COc1cc(C(C(N)=O)([N+]([O-])=NO)[N+]([O-])=NO)cc(OC)c1OC |
| InChI | InChI=1S/C11H15N5O8/c1-22-7-4-6(5-8(23-2)9(7)24-3)11(10(12)17,15(20)13-18)16(21)14-19/h4-5,18-19H,1-3H3,(H2,12,17) |
| InChIKey | BNMAMSOMUZFPOM-UHFFFAOYSA-N |
| XLogP | 0.05 |
| TPSA | 188.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.27 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|