About 4-[4-(3-iodophenyl)-5-pyridin-4-yl-1H-imidazol-2-yl]-2,6-dimethylphenol
4-[4-(3-iodophenyl)-5-pyridin-4-yl-1H-imidazol-2-yl]-2,6-dimethylphenol (PubChem CID 135434125) has the molecular formula C22H18IN3O
and a molecular weight of 467.31 g/mol. Its IUPAC name is 4-[4-(3-iodophenyl)-5-pyridin-4-yl-1H-imidazol-2-yl]-2,6-dimethylphenol.
Molecular Properties
| Compound Name | 4-[4-(3-iodophenyl)-5-pyridin-4-yl-1H-imidazol-2-yl]-2,6-dimethylphenol |
| PubChem CID | 135434125 |
| Molecular Formula | C22H18IN3O |
| Molecular Weight | 467.31 g/mol |
| Exact Mass | 467.05 |
| IUPAC Name | 4-[4-(3-iodophenyl)-5-pyridin-4-yl-1H-imidazol-2-yl]-2,6-dimethylphenol |
| SMILES | Cc1cc(-c2nc(-c3cccc(I)c3)c(-c3ccncc3)[nH]2)cc(C)c1O |
| InChI | InChI=1S/C22H18IN3O/c1-13-10-17(11-14(2)21(13)27)22-25-19(15-6-8-24-9-7-15)20(26-22)16-4-3-5-18(23)12-16/h3-12,27H,1-2H3,(H,25,26) |
| InChIKey | INLHZGSQTLPZOP-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 467.31 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 4-[4-(3-iodophenyl)-5-pyridin-4-yl-1H-imidazol-2-yl]-2,6-dimethylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[4-(3-iodophenyl)-5-pyridin-4-yl-1H-imidazol-2-yl]-2,6-dimethylphenol?
The IUPAC name of 4-[4-(3-iodophenyl)-5-pyridin-4-yl-1H-imidazol-2-yl]-2,6-dimethylphenol (CID 135434125) is 4-[4-(3-iodophenyl)-5-pyridin-4-yl-1H-imidazol-2-yl]-2,6-dimethylphenol.
What is the SMILES notation for 4-[4-(3-iodophenyl)-5-pyridin-4-yl-1H-imidazol-2-yl]-2,6-dimethylphenol?
The canonical SMILES for 4-[4-(3-iodophenyl)-5-pyridin-4-yl-1H-imidazol-2-yl]-2,6-dimethylphenol is Cc1cc(-c2nc(-c3cccc(I)c3)c(-c3ccncc3)[nH]2)cc(C)c1O.
What is the InChIKey of 4-[4-(3-iodophenyl)-5-pyridin-4-yl-1H-imidazol-2-yl]-2,6-dimethylphenol?
The InChIKey is INLHZGSQTLPZOP-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H18IN3O/c1-13-10-17(11-14(2)21(13)27)22-25-19(15-6-8-24-9-7-15)20(26-22)16-4-3-5-18(23)12-16/h3-12,27H,1-2H3,(H,25,26).
What are the key properties of 4-[4-(3-iodophenyl)-5-pyridin-4-yl-1H-imidazol-2-yl]-2,6-dimethylphenol?
4-[4-(3-iodophenyl)-5-pyridin-4-yl-1H-imidazol-2-yl]-2,6-dimethylphenol has a molecular weight of 467.31 g/mol, XLogP of 5.73, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[4-(3-iodophenyl)-5-pyridin-4-yl-1H-imidazol-2-yl]-2,6-dimethylphenol is sourced from PubChem (CID 135434125), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).