About 2,4-diamino-5-(2,4-dichlorophenyl)sulfanyl-1H-pyrimidin-6-one
2,4-diamino-5-(2,4-dichlorophenyl)sulfanyl-1H-pyrimidin-6-one (PubChem CID 135434147) has the molecular formula C10H8Cl2N4OS
and a molecular weight of 303.17 g/mol. Its IUPAC name is 2,4-diamino-5-(2,4-dichlorophenyl)sulfanyl-1H-pyrimidin-6-one.
Molecular Properties
| Compound Name | 2,4-diamino-5-(2,4-dichlorophenyl)sulfanyl-1H-pyrimidin-6-one |
| PubChem CID | 135434147 |
| Molecular Formula | C10H8Cl2N4OS |
| Molecular Weight | 303.17 g/mol |
| Exact Mass | 301.98 |
| IUPAC Name | 2,4-diamino-5-(2,4-dichlorophenyl)sulfanyl-1H-pyrimidin-6-one |
| SMILES | Nc1nc(N)c(Sc2ccc(Cl)cc2Cl)c(=O)[nH]1 |
| InChI | InChI=1S/C10H8Cl2N4OS/c11-4-1-2-6(5(12)3-4)18-7-8(13)15-10(14)16-9(7)17/h1-3H,(H5,13,14,15,16,17) |
| InChIKey | UWSACSNQQHYDSR-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 97.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 303.17 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2,4-diamino-5-(2,4-dichlorophenyl)sulfanyl-1H-pyrimidin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-diamino-5-(2,4-dichlorophenyl)sulfanyl-1H-pyrimidin-6-one?
The IUPAC name of 2,4-diamino-5-(2,4-dichlorophenyl)sulfanyl-1H-pyrimidin-6-one (CID 135434147) is 2,4-diamino-5-(2,4-dichlorophenyl)sulfanyl-1H-pyrimidin-6-one.
What is the SMILES notation for 2,4-diamino-5-(2,4-dichlorophenyl)sulfanyl-1H-pyrimidin-6-one?
The canonical SMILES for 2,4-diamino-5-(2,4-dichlorophenyl)sulfanyl-1H-pyrimidin-6-one is Nc1nc(N)c(Sc2ccc(Cl)cc2Cl)c(=O)[nH]1.
What is the InChIKey of 2,4-diamino-5-(2,4-dichlorophenyl)sulfanyl-1H-pyrimidin-6-one?
The InChIKey is UWSACSNQQHYDSR-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8Cl2N4OS/c11-4-1-2-6(5(12)3-4)18-7-8(13)15-10(14)16-9(7)17/h1-3H,(H5,13,14,15,16,17).
What are the key properties of 2,4-diamino-5-(2,4-dichlorophenyl)sulfanyl-1H-pyrimidin-6-one?
2,4-diamino-5-(2,4-dichlorophenyl)sulfanyl-1H-pyrimidin-6-one has a molecular weight of 303.17 g/mol, XLogP of 2.39, 2 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-diamino-5-(2,4-dichlorophenyl)sulfanyl-1H-pyrimidin-6-one is sourced from PubChem (CID 135434147), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).