C18H14N4O5 — CID 135434234
5-hydroxy-6-oxo-2-[2-(phenylcarbamoylamino)phenyl]-1H-pyrimidine-4-carboxylic acid (PubChem CID 135434234) has the molecular formula C18H14N4O5 and a molecular weight of 366.33 g/mol. Its IUPAC name is 5-hydroxy-6-oxo-2-[2-(phenylcarbamoylamino)phenyl]-1H-pyrimidine-4-carboxylic acid.
| Compound Name | 5-hydroxy-6-oxo-2-[2-(phenylcarbamoylamino)phenyl]-1H-pyrimidine-4-carboxylic acid |
|---|---|
| PubChem CID | 135434234 |
| Molecular Formula | C18H14N4O5 |
| Molecular Weight | 366.33 g/mol |
| Exact Mass | 366.10 |
| IUPAC Name | 5-hydroxy-6-oxo-2-[2-(phenylcarbamoylamino)phenyl]-1H-pyrimidine-4-carboxylic acid |
| SMILES | O=C(Nc1ccccc1)Nc1ccccc1-c1nc(C(=O)O)c(O)c(=O)[nH]1 |
| InChI | InChI=1S/C18H14N4O5/c23-14-13(17(25)26)21-15(22-16(14)24)11-8-4-5-9-12(11)20-18(27)19-10-6-2-1-3-7-10/h1-9,23H,(H,25,26)(H2,19,20,27)(H,21,22,24) |
| InChIKey | BVSZNDPDHKNYGQ-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 144.41 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.33 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |