C44H30N4O9S3 — CID 135434775
4-[20-phenyl-10,15-bis(4-sulfophenyl)-21,23-dihydroporphyrin-5-yl]benzenesulfonic acid (PubChem CID 135434775) has the molecular formula C44H30N4O9S3 and a molecular weight of 854.94 g/mol. Its IUPAC name is 4-[20-phenyl-10,15-bis(4-sulfophenyl)-21,23-dihydroporphyrin-5-yl]benzenesulfonic acid.
| Compound Name | 4-[20-phenyl-10,15-bis(4-sulfophenyl)-21,23-dihydroporphyrin-5-yl]benzenesulfonic acid |
|---|---|
| PubChem CID | 135434775 |
| Molecular Formula | C44H30N4O9S3 |
| Molecular Weight | 854.94 g/mol |
| Exact Mass | 854.12 |
| IUPAC Name | 4-[20-phenyl-10,15-bis(4-sulfophenyl)-21,23-dihydroporphyrin-5-yl]benzenesulfonic acid |
| SMILES | O=S(=O)(O)c1ccc(-c2c3nc(c(-c4ccc(S(=O)(=O)O)cc4)c4ccc([nH]4)c(-c4ccc(S(=O)(=O)O)cc4)c4nc(c(-c5ccccc5)c5ccc2[nH]5)C=C4)C=C3)cc1 |
| InChI | InChI=1S/C44H30N4O9S3/c49-58(50,51)30-12-6-27(7-13-30)42-35-20-18-33(45-35)41(26-4-2-1-3-5-26)34-19-21-36(46-34)43(28-8-14-31(15-9-28)59(52,53)54)38-23-25-40(48-38)44(39-24-22-37(42)47-39)29-10-16-32(17-11-29)60(55,56)57/h1-25,45,48H,(H,49,50,51)(H,52,53,54)(H,55,56,57)/b41-33-,41-34-,42-35-,42-37-,43-36-,43-38-,44-39-,44-40- |
| InChIKey | GMAZPPRNEQLIIU-LWQDQPMZSA-N |
| XLogP | 9.06 |
| TPSA | 220.47 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 854.94 |
| LogP ≤ 5 | 9.06 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|