C20H26N4O2 — CID 135434906
4-(4-methoxyphenyl)-2-(octylamino)-6-oxo-1H-pyrimidine-5-carbonitrile (PubChem CID 135434906) has the molecular formula C20H26N4O2 and a molecular weight of 354.45 g/mol. Its IUPAC name is 4-(4-methoxyphenyl)-2-(octylamino)-6-oxo-1H-pyrimidine-5-carbonitrile.
| Compound Name | 4-(4-methoxyphenyl)-2-(octylamino)-6-oxo-1H-pyrimidine-5-carbonitrile |
|---|---|
| PubChem CID | 135434906 |
| Molecular Formula | C20H26N4O2 |
| Molecular Weight | 354.45 g/mol |
| Exact Mass | 354.21 |
| IUPAC Name | 4-(4-methoxyphenyl)-2-(octylamino)-6-oxo-1H-pyrimidine-5-carbonitrile |
| SMILES | CCCCCCCCNc1nc(-c2ccc(OC)cc2)c(C#N)c(=O)[nH]1 |
| InChI | InChI=1S/C20H26N4O2/c1-3-4-5-6-7-8-13-22-20-23-18(17(14-21)19(25)24-20)15-9-11-16(26-2)12-10-15/h9-12H,3-8,13H2,1-2H3,(H2,22,23,24,25) |
| InChIKey | MWAPYMQIRLITQN-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 90.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.45 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyano_pyridone_B(27)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|