C22H30N2O2 — CID 135434934
(Z)-1-[3-[(Z)-2-hydroxy-4,4-dimethylpent-1-enyl]quinoxalin-2-yl]-4,4-dimethylpent-1-en-2-ol (PubChem CID 135434934) has the molecular formula C22H30N2O2 and a molecular weight of 354.49 g/mol. Its IUPAC name is (Z)-1-[3-[(Z)-2-hydroxy-4,4-dimethylpent-1-enyl]quinoxalin-2-yl]-4,4-dimethylpent-1-en-2-ol.
| Compound Name | (Z)-1-[3-[(Z)-2-hydroxy-4,4-dimethylpent-1-enyl]quinoxalin-2-yl]-4,4-dimethylpent-1-en-2-ol |
|---|---|
| PubChem CID | 135434934 |
| Molecular Formula | C22H30N2O2 |
| Molecular Weight | 354.49 g/mol |
| Exact Mass | 354.23 |
| IUPAC Name | (Z)-1-[3-[(Z)-2-hydroxy-4,4-dimethylpent-1-enyl]quinoxalin-2-yl]-4,4-dimethylpent-1-en-2-ol |
| SMILES | CC(C)(C)C/C(O)=C/c1nc2ccccc2nc1/C=C(\O)CC(C)(C)C |
| InChI | InChI=1S/C22H30N2O2/c1-21(2,3)13-15(25)11-19-20(12-16(26)14-22(4,5)6)24-18-10-8-7-9-17(18)23-19/h7-12,25-26H,13-14H2,1-6H3/b15-11-,16-12- |
| InChIKey | JYFDRIQRFCAFQZ-NFLUSIDLSA-N |
| XLogP | 6.30 |
| TPSA | 66.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.49 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het_66_C(2)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|