About 2-[3-(trifluoromethyl)anilino]-1,7-dihydropurin-6-one
2-[3-(trifluoromethyl)anilino]-1,7-dihydropurin-6-one (PubChem CID 135435057) has the molecular formula C12H8F3N5O
and a molecular weight of 295.22 g/mol. Its IUPAC name is 2-[3-(trifluoromethyl)anilino]-1,7-dihydropurin-6-one.
Molecular Properties
| Compound Name | 2-[3-(trifluoromethyl)anilino]-1,7-dihydropurin-6-one |
| PubChem CID | 135435057 |
| Molecular Formula | C12H8F3N5O |
| Molecular Weight | 295.22 g/mol |
| Exact Mass | 295.07 |
| IUPAC Name | 2-[3-(trifluoromethyl)anilino]-1,7-dihydropurin-6-one |
| SMILES | O=c1[nH]c(Nc2cccc(C(F)(F)F)c2)nc2nc[nH]c12 |
| InChI | InChI=1S/C12H8F3N5O/c13-12(14,15)6-2-1-3-7(4-6)18-11-19-9-8(10(21)20-11)16-5-17-9/h1-5H,(H3,16,17,18,19,20,21) |
| InChIKey | IOWPKEYIXBBDOQ-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 86.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 295.22 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[3-(trifluoromethyl)anilino]-1,7-dihydropurin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[3-(trifluoromethyl)anilino]-1,7-dihydropurin-6-one?
The IUPAC name of 2-[3-(trifluoromethyl)anilino]-1,7-dihydropurin-6-one (CID 135435057) is 2-[3-(trifluoromethyl)anilino]-1,7-dihydropurin-6-one.
What is the SMILES notation for 2-[3-(trifluoromethyl)anilino]-1,7-dihydropurin-6-one?
The canonical SMILES for 2-[3-(trifluoromethyl)anilino]-1,7-dihydropurin-6-one is O=c1[nH]c(Nc2cccc(C(F)(F)F)c2)nc2nc[nH]c12.
What is the InChIKey of 2-[3-(trifluoromethyl)anilino]-1,7-dihydropurin-6-one?
The InChIKey is IOWPKEYIXBBDOQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H8F3N5O/c13-12(14,15)6-2-1-3-7(4-6)18-11-19-9-8(10(21)20-11)16-5-17-9/h1-5H,(H3,16,17,18,19,20,21).
What are the key properties of 2-[3-(trifluoromethyl)anilino]-1,7-dihydropurin-6-one?
2-[3-(trifluoromethyl)anilino]-1,7-dihydropurin-6-one has a molecular weight of 295.22 g/mol, XLogP of 2.41, 2 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3-(trifluoromethyl)anilino]-1,7-dihydropurin-6-one is sourced from PubChem (CID 135435057), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).