About 3-butyl-7H-purin-6-imine
3-butyl-7H-purin-6-imine (PubChem CID 135435069) has the molecular formula C9H13N5
and a molecular weight of 191.24 g/mol. Its IUPAC name is 3-butyl-7H-purin-6-imine.
Molecular Properties
| Compound Name | 3-butyl-7H-purin-6-imine |
| PubChem CID | 135435069 |
| Molecular Formula | C9H13N5 |
| Molecular Weight | 191.24 g/mol |
| Exact Mass | 191.12 |
| IUPAC Name | 3-butyl-7H-purin-6-imine |
| SMILES | [H]/N=c1\ncn(CCCC)c2nc[nH]c12 |
| InChI | InChI=1S/C9H13N5/c1-2-3-4-14-6-13-8(10)7-9(14)12-5-11-7/h5-6,10H,2-4H2,1H3,(H,11,12)/b10-8- |
| InChIKey | XUUSCYDENQIJSX-NTMALXAHSA-N |
| XLogP | 1.04 |
| TPSA | 70.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.24 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-butyl-7H-purin-6-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-butyl-7H-purin-6-imine?
The IUPAC name of 3-butyl-7H-purin-6-imine (CID 135435069) is 3-butyl-7H-purin-6-imine.
What is the SMILES notation for 3-butyl-7H-purin-6-imine?
The canonical SMILES for 3-butyl-7H-purin-6-imine is [H]/N=c1\ncn(CCCC)c2nc[nH]c12.
What is the InChIKey of 3-butyl-7H-purin-6-imine?
The InChIKey is XUUSCYDENQIJSX-NTMALXAHSA-N. The full InChI is InChI=1S/C9H13N5/c1-2-3-4-14-6-13-8(10)7-9(14)12-5-11-7/h5-6,10H,2-4H2,1H3,(H,11,12)/b10-8-.
What are the key properties of 3-butyl-7H-purin-6-imine?
3-butyl-7H-purin-6-imine has a molecular weight of 191.24 g/mol, XLogP of 1.04, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-butyl-7H-purin-6-imine is sourced from PubChem (CID 135435069), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).