About 3-hexyl-7H-purin-6-imine
3-hexyl-7H-purin-6-imine (PubChem CID 135435071) has the molecular formula C11H17N5
and a molecular weight of 219.29 g/mol. Its IUPAC name is 3-hexyl-7H-purin-6-imine.
Molecular Properties
| Compound Name | 3-hexyl-7H-purin-6-imine |
| PubChem CID | 135435071 |
| Molecular Formula | C11H17N5 |
| Molecular Weight | 219.29 g/mol |
| Exact Mass | 219.15 |
| IUPAC Name | 3-hexyl-7H-purin-6-imine |
| SMILES | [H]/N=c1\ncn(CCCCCC)c2nc[nH]c12 |
| InChI | InChI=1S/C11H17N5/c1-2-3-4-5-6-16-8-15-10(12)9-11(16)14-7-13-9/h7-8,12H,2-6H2,1H3,(H,13,14)/b12-10- |
| InChIKey | MWSXUECTOCQJQB-BENRWUELSA-N |
| XLogP | 1.82 |
| TPSA | 70.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.29 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-hexyl-7H-purin-6-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-hexyl-7H-purin-6-imine?
The IUPAC name of 3-hexyl-7H-purin-6-imine (CID 135435071) is 3-hexyl-7H-purin-6-imine.
What is the SMILES notation for 3-hexyl-7H-purin-6-imine?
The canonical SMILES for 3-hexyl-7H-purin-6-imine is [H]/N=c1\ncn(CCCCCC)c2nc[nH]c12.
What is the InChIKey of 3-hexyl-7H-purin-6-imine?
The InChIKey is MWSXUECTOCQJQB-BENRWUELSA-N. The full InChI is InChI=1S/C11H17N5/c1-2-3-4-5-6-16-8-15-10(12)9-11(16)14-7-13-9/h7-8,12H,2-6H2,1H3,(H,13,14)/b12-10-.
What are the key properties of 3-hexyl-7H-purin-6-imine?
3-hexyl-7H-purin-6-imine has a molecular weight of 219.29 g/mol, XLogP of 1.82, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-hexyl-7H-purin-6-imine is sourced from PubChem (CID 135435071), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).