About 2-(4-butylanilino)-1,7-dihydropurin-6-one
2-(4-butylanilino)-1,7-dihydropurin-6-one (PubChem CID 135435084) has the molecular formula C15H17N5O
and a molecular weight of 283.34 g/mol. Its IUPAC name is 2-(4-butylanilino)-1,7-dihydropurin-6-one.
Molecular Properties
| Compound Name | 2-(4-butylanilino)-1,7-dihydropurin-6-one |
| PubChem CID | 135435084 |
| Molecular Formula | C15H17N5O |
| Molecular Weight | 283.34 g/mol |
| Exact Mass | 283.14 |
| IUPAC Name | 2-(4-butylanilino)-1,7-dihydropurin-6-one |
| SMILES | CCCCc1ccc(Nc2nc3nc[nH]c3c(=O)[nH]2)cc1 |
| InChI | InChI=1S/C15H17N5O/c1-2-3-4-10-5-7-11(8-6-10)18-15-19-13-12(14(21)20-15)16-9-17-13/h5-9H,2-4H2,1H3,(H3,16,17,18,19,20,21) |
| InChIKey | OPAPDEANGWQVRT-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 86.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.34 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(4-butylanilino)-1,7-dihydropurin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-butylanilino)-1,7-dihydropurin-6-one?
The IUPAC name of 2-(4-butylanilino)-1,7-dihydropurin-6-one (CID 135435084) is 2-(4-butylanilino)-1,7-dihydropurin-6-one.
What is the SMILES notation for 2-(4-butylanilino)-1,7-dihydropurin-6-one?
The canonical SMILES for 2-(4-butylanilino)-1,7-dihydropurin-6-one is CCCCc1ccc(Nc2nc3nc[nH]c3c(=O)[nH]2)cc1.
What is the InChIKey of 2-(4-butylanilino)-1,7-dihydropurin-6-one?
The InChIKey is OPAPDEANGWQVRT-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H17N5O/c1-2-3-4-10-5-7-11(8-6-10)18-15-19-13-12(14(21)20-15)16-9-17-13/h5-9H,2-4H2,1H3,(H3,16,17,18,19,20,21).
What are the key properties of 2-(4-butylanilino)-1,7-dihydropurin-6-one?
2-(4-butylanilino)-1,7-dihydropurin-6-one has a molecular weight of 283.34 g/mol, XLogP of 2.73, 5 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-butylanilino)-1,7-dihydropurin-6-one is sourced from PubChem (CID 135435084), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).