About 1-[(2,4-dichlorophenyl)methoxy]-3-(hydroxyiminomethyl)urea
1-[(2,4-dichlorophenyl)methoxy]-3-(hydroxyiminomethyl)urea (PubChem CID 135435217) has the molecular formula C9H9Cl2N3O3
and a molecular weight of 278.10 g/mol. Its IUPAC name is 1-[(2,4-dichlorophenyl)methoxy]-3-(hydroxyiminomethyl)urea.
Molecular Properties
| Compound Name | 1-[(2,4-dichlorophenyl)methoxy]-3-(hydroxyiminomethyl)urea |
| PubChem CID | 135435217 |
| Molecular Formula | C9H9Cl2N3O3 |
| Molecular Weight | 278.10 g/mol |
| Exact Mass | 277.00 |
| IUPAC Name | 1-[(2,4-dichlorophenyl)methoxy]-3-(hydroxyiminomethyl)urea |
| SMILES | O=C(NC=NO)NOCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C9H9Cl2N3O3/c10-7-2-1-6(8(11)3-7)4-17-14-9(15)12-5-13-16/h1-3,5,16H,4H2,(H2,12,13,14,15) |
| InChIKey | INYLKSIJMGWQKT-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 82.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.10 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-[(2,4-dichlorophenyl)methoxy]-3-(hydroxyiminomethyl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(2,4-dichlorophenyl)methoxy]-3-(hydroxyiminomethyl)urea?
The IUPAC name of 1-[(2,4-dichlorophenyl)methoxy]-3-(hydroxyiminomethyl)urea (CID 135435217) is 1-[(2,4-dichlorophenyl)methoxy]-3-(hydroxyiminomethyl)urea.
What is the SMILES notation for 1-[(2,4-dichlorophenyl)methoxy]-3-(hydroxyiminomethyl)urea?
The canonical SMILES for 1-[(2,4-dichlorophenyl)methoxy]-3-(hydroxyiminomethyl)urea is O=C(NC=NO)NOCc1ccc(Cl)cc1Cl.
What is the InChIKey of 1-[(2,4-dichlorophenyl)methoxy]-3-(hydroxyiminomethyl)urea?
The InChIKey is INYLKSIJMGWQKT-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9Cl2N3O3/c10-7-2-1-6(8(11)3-7)4-17-14-9(15)12-5-13-16/h1-3,5,16H,4H2,(H2,12,13,14,15).
What are the key properties of 1-[(2,4-dichlorophenyl)methoxy]-3-(hydroxyiminomethyl)urea?
1-[(2,4-dichlorophenyl)methoxy]-3-(hydroxyiminomethyl)urea has a molecular weight of 278.10 g/mol, XLogP of 2.14, 4 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(2,4-dichlorophenyl)methoxy]-3-(hydroxyiminomethyl)urea is sourced from PubChem (CID 135435217), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).