About methyl N-[1,3-bis(hydroxyimino)propan-2-ylideneamino]carbamate
methyl N-[1,3-bis(hydroxyimino)propan-2-ylideneamino]carbamate (PubChem CID 135435471) has the molecular formula C5H8N4O4
and a molecular weight of 188.14 g/mol. Its IUPAC name is methyl N-[1,3-bis(hydroxyimino)propan-2-ylideneamino]carbamate.
Molecular Properties
| Compound Name | methyl N-[1,3-bis(hydroxyimino)propan-2-ylideneamino]carbamate |
| PubChem CID | 135435471 |
| Molecular Formula | C5H8N4O4 |
| Molecular Weight | 188.14 g/mol |
| Exact Mass | 188.05 |
| IUPAC Name | methyl N-[1,3-bis(hydroxyimino)propan-2-ylideneamino]carbamate |
| SMILES | COC(=O)NN=C(C=NO)C=NO |
| InChI | InChI=1S/C5H8N4O4/c1-13-5(10)9-8-4(2-6-11)3-7-12/h2-3,11-12H,1H3,(H,9,10) |
| InChIKey | POTQIVNYAAKQII-UHFFFAOYSA-N |
| XLogP | -0.38 |
| TPSA | 115.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.14 |
| LogP ≤ 5 | -0.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze methyl N-[1,3-bis(hydroxyimino)propan-2-ylideneamino]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl N-[1,3-bis(hydroxyimino)propan-2-ylideneamino]carbamate?
The IUPAC name of methyl N-[1,3-bis(hydroxyimino)propan-2-ylideneamino]carbamate (CID 135435471) is methyl N-[1,3-bis(hydroxyimino)propan-2-ylideneamino]carbamate.
What is the SMILES notation for methyl N-[1,3-bis(hydroxyimino)propan-2-ylideneamino]carbamate?
The canonical SMILES for methyl N-[1,3-bis(hydroxyimino)propan-2-ylideneamino]carbamate is COC(=O)NN=C(C=NO)C=NO.
What is the InChIKey of methyl N-[1,3-bis(hydroxyimino)propan-2-ylideneamino]carbamate?
The InChIKey is POTQIVNYAAKQII-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8N4O4/c1-13-5(10)9-8-4(2-6-11)3-7-12/h2-3,11-12H,1H3,(H,9,10).
What are the key properties of methyl N-[1,3-bis(hydroxyimino)propan-2-ylideneamino]carbamate?
methyl N-[1,3-bis(hydroxyimino)propan-2-ylideneamino]carbamate has a molecular weight of 188.14 g/mol, XLogP of -0.38, 3 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for methyl N-[1,3-bis(hydroxyimino)propan-2-ylideneamino]carbamate is sourced from PubChem (CID 135435471), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).