About 4-ethylsulfanyl-1,7-dihydropyrazolo[5,4-d]pyrimidine-6-thione
4-ethylsulfanyl-1,7-dihydropyrazolo[5,4-d]pyrimidine-6-thione (PubChem CID 135436393) has the molecular formula C7H8N4S2
and a molecular weight of 212.30 g/mol. Its IUPAC name is 4-ethylsulfanyl-1,7-dihydropyrazolo[5,4-d]pyrimidine-6-thione.
Molecular Properties
| Compound Name | 4-ethylsulfanyl-1,7-dihydropyrazolo[5,4-d]pyrimidine-6-thione |
| PubChem CID | 135436393 |
| Molecular Formula | C7H8N4S2 |
| Molecular Weight | 212.30 g/mol |
| Exact Mass | 212.02 |
| IUPAC Name | 4-ethylsulfanyl-1,7-dihydropyrazolo[5,4-d]pyrimidine-6-thione |
| SMILES | CCSc1nc(=S)[nH]c2[nH]ncc12 |
| InChI | InChI=1S/C7H8N4S2/c1-2-13-6-4-3-8-11-5(4)9-7(12)10-6/h3H,2H2,1H3,(H2,8,9,10,11,12) |
| InChIKey | KNJPYDHMFGGCNS-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.30 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 4-ethylsulfanyl-1,7-dihydropyrazolo[5,4-d]pyrimidine-6-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethylsulfanyl-1,7-dihydropyrazolo[5,4-d]pyrimidine-6-thione?
The IUPAC name of 4-ethylsulfanyl-1,7-dihydropyrazolo[5,4-d]pyrimidine-6-thione (CID 135436393) is 4-ethylsulfanyl-1,7-dihydropyrazolo[5,4-d]pyrimidine-6-thione.
What is the SMILES notation for 4-ethylsulfanyl-1,7-dihydropyrazolo[5,4-d]pyrimidine-6-thione?
The canonical SMILES for 4-ethylsulfanyl-1,7-dihydropyrazolo[5,4-d]pyrimidine-6-thione is CCSc1nc(=S)[nH]c2[nH]ncc12.
What is the InChIKey of 4-ethylsulfanyl-1,7-dihydropyrazolo[5,4-d]pyrimidine-6-thione?
The InChIKey is KNJPYDHMFGGCNS-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8N4S2/c1-2-13-6-4-3-8-11-5(4)9-7(12)10-6/h3H,2H2,1H3,(H2,8,9,10,11,12).
What are the key properties of 4-ethylsulfanyl-1,7-dihydropyrazolo[5,4-d]pyrimidine-6-thione?
4-ethylsulfanyl-1,7-dihydropyrazolo[5,4-d]pyrimidine-6-thione has a molecular weight of 212.30 g/mol, XLogP of 2.13, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethylsulfanyl-1,7-dihydropyrazolo[5,4-d]pyrimidine-6-thione is sourced from PubChem (CID 135436393), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).