About 4-hydrazinyl-1,7-dihydropyrazolo[5,4-d]pyrimidine-6-thione
4-hydrazinyl-1,7-dihydropyrazolo[5,4-d]pyrimidine-6-thione (PubChem CID 135436411) has the molecular formula C5H6N6S
and a molecular weight of 182.21 g/mol. Its IUPAC name is 4-hydrazinyl-1,7-dihydropyrazolo[5,4-d]pyrimidine-6-thione.
Molecular Properties
| Compound Name | 4-hydrazinyl-1,7-dihydropyrazolo[5,4-d]pyrimidine-6-thione |
| PubChem CID | 135436411 |
| Molecular Formula | C5H6N6S |
| Molecular Weight | 182.21 g/mol |
| Exact Mass | 182.04 |
| IUPAC Name | 4-hydrazinyl-1,7-dihydropyrazolo[5,4-d]pyrimidine-6-thione |
| SMILES | NNc1nc(=S)[nH]c2[nH]ncc12 |
| InChI | InChI=1S/C5H6N6S/c6-10-3-2-1-7-11-4(2)9-5(12)8-3/h1H,6H2,(H3,7,8,9,10,11,12) |
| InChIKey | DSMNEIWIHTTXIO-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 95.41 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.21 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 4-hydrazinyl-1,7-dihydropyrazolo[5,4-d]pyrimidine-6-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-hydrazinyl-1,7-dihydropyrazolo[5,4-d]pyrimidine-6-thione?
The IUPAC name of 4-hydrazinyl-1,7-dihydropyrazolo[5,4-d]pyrimidine-6-thione (CID 135436411) is 4-hydrazinyl-1,7-dihydropyrazolo[5,4-d]pyrimidine-6-thione.
What is the SMILES notation for 4-hydrazinyl-1,7-dihydropyrazolo[5,4-d]pyrimidine-6-thione?
The canonical SMILES for 4-hydrazinyl-1,7-dihydropyrazolo[5,4-d]pyrimidine-6-thione is NNc1nc(=S)[nH]c2[nH]ncc12.
What is the InChIKey of 4-hydrazinyl-1,7-dihydropyrazolo[5,4-d]pyrimidine-6-thione?
The InChIKey is DSMNEIWIHTTXIO-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H6N6S/c6-10-3-2-1-7-11-4(2)9-5(12)8-3/h1H,6H2,(H3,7,8,9,10,11,12).
What are the key properties of 4-hydrazinyl-1,7-dihydropyrazolo[5,4-d]pyrimidine-6-thione?
4-hydrazinyl-1,7-dihydropyrazolo[5,4-d]pyrimidine-6-thione has a molecular weight of 182.21 g/mol, XLogP of 0.30, 1 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-hydrazinyl-1,7-dihydropyrazolo[5,4-d]pyrimidine-6-thione is sourced from PubChem (CID 135436411), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).