C15H8Cl5N3O — CID 135436551
5-(2,4-dichlorophenyl)imino-2-(2,4,6-trichlorophenyl)pyrazolidin-3-one (PubChem CID 135436551) has the molecular formula C15H8Cl5N3O and a molecular weight of 423.51 g/mol. Its IUPAC name is 5-(2,4-dichlorophenyl)imino-2-(2,4,6-trichlorophenyl)pyrazolidin-3-one.
| Compound Name | 5-(2,4-dichlorophenyl)imino-2-(2,4,6-trichlorophenyl)pyrazolidin-3-one |
|---|---|
| PubChem CID | 135436551 |
| Molecular Formula | C15H8Cl5N3O |
| Molecular Weight | 423.51 g/mol |
| Exact Mass | 420.91 |
| IUPAC Name | 5-(2,4-dichlorophenyl)imino-2-(2,4,6-trichlorophenyl)pyrazolidin-3-one |
| SMILES | O=C1C/C(=N\c2ccc(Cl)cc2Cl)NN1c1c(Cl)cc(Cl)cc1Cl |
| InChI | InChI=1S/C15H8Cl5N3O/c16-7-1-2-12(9(18)3-7)21-13-6-14(24)23(22-13)15-10(19)4-8(17)5-11(15)20/h1-5H,6H2,(H,21,22) |
| InChIKey | SFHFZFPJBHUPNX-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 44.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.51 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|