C12H14F3N3O2S — CID 135436591
N-butan-2-yl-1,1-dioxo-7-(trifluoromethyl)-4H-1λ6,2,4-benzothiadiazin-3-imine (PubChem CID 135436591) has the molecular formula C12H14F3N3O2S and a molecular weight of 321.32 g/mol. Its IUPAC name is N-butan-2-yl-1,1-dioxo-7-(trifluoromethyl)-4H-1λ6,2,4-benzothiadiazin-3-imine.
| Compound Name | N-butan-2-yl-1,1-dioxo-7-(trifluoromethyl)-4H-1λ6,2,4-benzothiadiazin-3-imine |
|---|---|
| PubChem CID | 135436591 |
| Molecular Formula | C12H14F3N3O2S |
| Molecular Weight | 321.32 g/mol |
| Exact Mass | 321.08 |
| IUPAC Name | N-butan-2-yl-1,1-dioxo-7-(trifluoromethyl)-4H-1λ6,2,4-benzothiadiazin-3-imine |
| SMILES | CCC(C)/N=C1\Nc2ccc(C(F)(F)F)cc2S(=O)(=O)N1 |
| InChI | InChI=1S/C12H14F3N3O2S/c1-3-7(2)16-11-17-9-5-4-8(12(13,14)15)6-10(9)21(19,20)18-11/h4-7H,3H2,1-2H3,(H2,16,17,18) |
| InChIKey | SPOICDXSIBSZGJ-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.32 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|