C25H21N3O3 — CID 135436677
4-(1-benzyl-7,8-dimethoxy-2H-pyrazolo[3,4-c]isoquinolin-5-yl)phenol (PubChem CID 135436677) has the molecular formula C25H21N3O3 and a molecular weight of 411.46 g/mol. Its IUPAC name is 4-(1-benzyl-7,8-dimethoxy-2H-pyrazolo[3,4-c]isoquinolin-5-yl)phenol.
| Compound Name | 4-(1-benzyl-7,8-dimethoxy-2H-pyrazolo[3,4-c]isoquinolin-5-yl)phenol |
|---|---|
| PubChem CID | 135436677 |
| Molecular Formula | C25H21N3O3 |
| Molecular Weight | 411.46 g/mol |
| Exact Mass | 411.16 |
| IUPAC Name | 4-(1-benzyl-7,8-dimethoxy-2H-pyrazolo[3,4-c]isoquinolin-5-yl)phenol |
| SMILES | COc1cc2c(-c3ccc(O)cc3)nc3n[nH]c(Cc4ccccc4)c3c2cc1OC |
| InChI | InChI=1S/C25H21N3O3/c1-30-21-13-18-19(14-22(21)31-2)24(16-8-10-17(29)11-9-16)26-25-23(18)20(27-28-25)12-15-6-4-3-5-7-15/h3-11,13-14,29H,12H2,1-2H3,(H,26,27,28) |
| InChIKey | TWKRTTOVCFKFPW-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 80.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.46 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |