About N-(4-acetylphenyl)-4-(5,7-dioxopyrrolo[3,4-b]pyridin-6-yl)benzamide
N-(4-acetylphenyl)-4-(5,7-dioxopyrrolo[3,4-b]pyridin-6-yl)benzamide (PubChem CID 1354369) has the molecular formula C22H15N3O4
and a molecular weight of 385.38 g/mol. Its IUPAC name is N-(4-acetylphenyl)-4-(5,7-dioxopyrrolo[3,4-b]pyridin-6-yl)benzamide.
Molecular Properties
| Compound Name | N-(4-acetylphenyl)-4-(5,7-dioxopyrrolo[3,4-b]pyridin-6-yl)benzamide |
| PubChem CID | 1354369 |
| Molecular Formula | C22H15N3O4 |
| Molecular Weight | 385.38 g/mol |
| Exact Mass | 385.11 |
| IUPAC Name | N-(4-acetylphenyl)-4-(5,7-dioxopyrrolo[3,4-b]pyridin-6-yl)benzamide |
| SMILES | CC(=O)c1ccc(NC(=O)c2ccc(N3C(=O)c4cccnc4C3=O)cc2)cc1 |
| InChI | InChI=1S/C22H15N3O4/c1-13(26)14-4-8-16(9-5-14)24-20(27)15-6-10-17(11-7-15)25-21(28)18-3-2-12-23-19(18)22(25)29/h2-12H,1H3,(H,24,27) |
| InChIKey | KGULXBWUEFIXED-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 96.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 385.38 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze N-(4-acetylphenyl)-4-(5,7-dioxopyrrolo[3,4-b]pyridin-6-yl)benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4-acetylphenyl)-4-(5,7-dioxopyrrolo[3,4-b]pyridin-6-yl)benzamide?
The IUPAC name of N-(4-acetylphenyl)-4-(5,7-dioxopyrrolo[3,4-b]pyridin-6-yl)benzamide (CID 1354369) is N-(4-acetylphenyl)-4-(5,7-dioxopyrrolo[3,4-b]pyridin-6-yl)benzamide.
What is the SMILES notation for N-(4-acetylphenyl)-4-(5,7-dioxopyrrolo[3,4-b]pyridin-6-yl)benzamide?
The canonical SMILES for N-(4-acetylphenyl)-4-(5,7-dioxopyrrolo[3,4-b]pyridin-6-yl)benzamide is CC(=O)c1ccc(NC(=O)c2ccc(N3C(=O)c4cccnc4C3=O)cc2)cc1.
What is the InChIKey of N-(4-acetylphenyl)-4-(5,7-dioxopyrrolo[3,4-b]pyridin-6-yl)benzamide?
The InChIKey is KGULXBWUEFIXED-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H15N3O4/c1-13(26)14-4-8-16(9-5-14)24-20(27)15-6-10-17(11-7-15)25-21(28)18-3-2-12-23-19(18)22(25)29/h2-12H,1H3,(H,24,27).
What are the key properties of N-(4-acetylphenyl)-4-(5,7-dioxopyrrolo[3,4-b]pyridin-6-yl)benzamide?
N-(4-acetylphenyl)-4-(5,7-dioxopyrrolo[3,4-b]pyridin-6-yl)benzamide has a molecular weight of 385.38 g/mol, XLogP of 3.34, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4-acetylphenyl)-4-(5,7-dioxopyrrolo[3,4-b]pyridin-6-yl)benzamide is sourced from PubChem (CID 1354369), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).