About 8-bromo-1-(3,4-dihydroxybenzoyl)-7-hydroxy-6-methoxyisoquinoline-3-carboxylic acid
8-bromo-1-(3,4-dihydroxybenzoyl)-7-hydroxy-6-methoxyisoquinoline-3-carboxylic acid (PubChem CID 135437180) has the molecular formula C18H12BrNO7
and a molecular weight of 434.20 g/mol. Its IUPAC name is 8-bromo-1-(3,4-dihydroxybenzoyl)-7-hydroxy-6-methoxyisoquinoline-3-carboxylic acid.
Molecular Properties
| Compound Name | 8-bromo-1-(3,4-dihydroxybenzoyl)-7-hydroxy-6-methoxyisoquinoline-3-carboxylic acid |
| PubChem CID | 135437180 |
| Molecular Formula | C18H12BrNO7 |
| Molecular Weight | 434.20 g/mol |
| Exact Mass | 432.98 |
| IUPAC Name | 8-bromo-1-(3,4-dihydroxybenzoyl)-7-hydroxy-6-methoxyisoquinoline-3-carboxylic acid |
| SMILES | COc1cc2cc(C(=O)O)nc(C(=O)c3ccc(O)c(O)c3)c2c(Br)c1O |
| InChI | InChI=1S/C18H12BrNO7/c1-27-12-6-8-4-9(18(25)26)20-15(13(8)14(19)17(12)24)16(23)7-2-3-10(21)11(22)5-7/h2-6,21-22,24H,1H3,(H,25,26) |
| InChIKey | IJKZXTUQQILWMJ-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 137.18 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 434.20 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|
Analyze 8-bromo-1-(3,4-dihydroxybenzoyl)-7-hydroxy-6-methoxyisoquinoline-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-bromo-1-(3,4-dihydroxybenzoyl)-7-hydroxy-6-methoxyisoquinoline-3-carboxylic acid?
The IUPAC name of 8-bromo-1-(3,4-dihydroxybenzoyl)-7-hydroxy-6-methoxyisoquinoline-3-carboxylic acid (CID 135437180) is 8-bromo-1-(3,4-dihydroxybenzoyl)-7-hydroxy-6-methoxyisoquinoline-3-carboxylic acid.
What is the SMILES notation for 8-bromo-1-(3,4-dihydroxybenzoyl)-7-hydroxy-6-methoxyisoquinoline-3-carboxylic acid?
The canonical SMILES for 8-bromo-1-(3,4-dihydroxybenzoyl)-7-hydroxy-6-methoxyisoquinoline-3-carboxylic acid is COc1cc2cc(C(=O)O)nc(C(=O)c3ccc(O)c(O)c3)c2c(Br)c1O.
What is the InChIKey of 8-bromo-1-(3,4-dihydroxybenzoyl)-7-hydroxy-6-methoxyisoquinoline-3-carboxylic acid?
The InChIKey is IJKZXTUQQILWMJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H12BrNO7/c1-27-12-6-8-4-9(18(25)26)20-15(13(8)14(19)17(12)24)16(23)7-2-3-10(21)11(22)5-7/h2-6,21-22,24H,1H3,(H,25,26).
What are the key properties of 8-bromo-1-(3,4-dihydroxybenzoyl)-7-hydroxy-6-methoxyisoquinoline-3-carboxylic acid?
8-bromo-1-(3,4-dihydroxybenzoyl)-7-hydroxy-6-methoxyisoquinoline-3-carboxylic acid has a molecular weight of 434.20 g/mol, XLogP of 3.05, 4 rotatable bonds, 4 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 8-bromo-1-(3,4-dihydroxybenzoyl)-7-hydroxy-6-methoxyisoquinoline-3-carboxylic acid is sourced from PubChem (CID 135437180), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).