C34H33N3O9S — CID 135438008
3-[(E)-[[cyclohexyl(methyl)carbamothioyl]hydrazinylidene]methyl]-1,9,11,14-tetrahydroxy-7-methoxy-10-methyl-8,13-dioxo-5,6-dihydrobenzo[a]tetracene-2-carboxylic acid (PubChem CID 135438008) has the molecular formula C34H33N3O9S and a molecular weight of 659.72 g/mol. Its IUPAC name is 3-[(E)-[[cyclohexyl(methyl)carbamothioyl]hydrazinylidene]methyl]-1,9,11,14-tetrahydroxy-7-methoxy-10-methyl-8,13-dioxo-5,6-dihydrobenzo[a]tetracene-2-carboxylic acid.
| Compound Name | 3-[(E)-[[cyclohexyl(methyl)carbamothioyl]hydrazinylidene]methyl]-1,9,11,14-tetrahydroxy-7-methoxy-10-methyl-8,13-dioxo-5,6-dihydrobenzo[a]tetracene-2-carboxylic acid |
|---|---|
| PubChem CID | 135438008 |
| Molecular Formula | C34H33N3O9S |
| Molecular Weight | 659.72 g/mol |
| Exact Mass | 659.19 |
| IUPAC Name | 3-[(E)-[[cyclohexyl(methyl)carbamothioyl]hydrazinylidene]methyl]-1,9,11,14-tetrahydroxy-7-methoxy-10-methyl-8,13-dioxo-5,6-dihydrobenzo[a]tetracene-2-carboxylic acid |
| SMILES | COc1c2c(c(O)c3c1C(=O)c1c(cc(O)c(C)c1O)C3=O)-c1c(cc(/C=N/NC(=S)N(C)C3CCCCC3)c(C(=O)O)c1O)CC2 |
| InChI | InChI=1S/C34H33N3O9S/c1-14-20(38)12-19-24(27(14)39)31(43)26-25(28(19)40)30(42)23-18(32(26)46-3)10-9-15-11-16(22(33(44)45)29(41)21(15)23)13-35-36-34(47)37(2)17-7-5-4-6-8-17/h11-13,17,38-39,41-42H,4-10H2,1-3H3,(H,36,47)(H,44,45)/b35-13+ |
| InChIKey | YQDXPVFVMOHQLO-JAVXJAORSA-N |
| XLogP | 4.54 |
| TPSA | 189.22 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 659.72 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|