About 3,5-dinitro-2H-indazole
3,5-dinitro-2H-indazole (PubChem CID 135438114) has the molecular formula C7H4N4O4
and a molecular weight of 208.13 g/mol. Its IUPAC name is 3,5-dinitro-2H-indazole.
Molecular Properties
| Compound Name | 3,5-dinitro-2H-indazole |
| PubChem CID | 135438114 |
| Molecular Formula | C7H4N4O4 |
| Molecular Weight | 208.13 g/mol |
| Exact Mass | 208.02 |
| IUPAC Name | 3,5-dinitro-2H-indazole |
| SMILES | O=[N+]([O-])c1ccc2n[nH]c([N+](=O)[O-])c2c1 |
| InChI | InChI=1S/C7H4N4O4/c12-10(13)4-1-2-6-5(3-4)7(9-8-6)11(14)15/h1-3H,(H,8,9) |
| InChIKey | WETUVJKNAJERIU-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 114.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.13 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3,5-dinitro-2H-indazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,5-dinitro-2H-indazole?
The IUPAC name of 3,5-dinitro-2H-indazole (CID 135438114) is 3,5-dinitro-2H-indazole.
What is the SMILES notation for 3,5-dinitro-2H-indazole?
The canonical SMILES for 3,5-dinitro-2H-indazole is O=[N+]([O-])c1ccc2n[nH]c([N+](=O)[O-])c2c1.
What is the InChIKey of 3,5-dinitro-2H-indazole?
The InChIKey is WETUVJKNAJERIU-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H4N4O4/c12-10(13)4-1-2-6-5(3-4)7(9-8-6)11(14)15/h1-3H,(H,8,9).
What are the key properties of 3,5-dinitro-2H-indazole?
3,5-dinitro-2H-indazole has a molecular weight of 208.13 g/mol, XLogP of 1.38, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-dinitro-2H-indazole is sourced from PubChem (CID 135438114), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).