About 1-[(E)-(3,5-dichloro-2-hydroxyphenyl)methylideneamino]-3-hydroxyurea
1-[(E)-(3,5-dichloro-2-hydroxyphenyl)methylideneamino]-3-hydroxyurea (PubChem CID 135438167) has the molecular formula C8H7Cl2N3O3
and a molecular weight of 264.07 g/mol. Its IUPAC name is 1-[(E)-(3,5-dichloro-2-hydroxyphenyl)methylideneamino]-3-hydroxyurea.
Molecular Properties
| Compound Name | 1-[(E)-(3,5-dichloro-2-hydroxyphenyl)methylideneamino]-3-hydroxyurea |
| PubChem CID | 135438167 |
| Molecular Formula | C8H7Cl2N3O3 |
| Molecular Weight | 264.07 g/mol |
| Exact Mass | 262.99 |
| IUPAC Name | 1-[(E)-(3,5-dichloro-2-hydroxyphenyl)methylideneamino]-3-hydroxyurea |
| SMILES | O=C(NO)N/N=C/c1cc(Cl)cc(Cl)c1O |
| InChI | InChI=1S/C8H7Cl2N3O3/c9-5-1-4(7(14)6(10)2-5)3-11-12-8(15)13-16/h1-3,14,16H,(H2,12,13,15)/b11-3+ |
| InChIKey | MKSXBJJBRMGIJI-QDEBKDIKSA-N |
| XLogP | 1.72 |
| TPSA | 93.95 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.07 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-[(E)-(3,5-dichloro-2-hydroxyphenyl)methylideneamino]-3-hydroxyurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(E)-(3,5-dichloro-2-hydroxyphenyl)methylideneamino]-3-hydroxyurea?
The IUPAC name of 1-[(E)-(3,5-dichloro-2-hydroxyphenyl)methylideneamino]-3-hydroxyurea (CID 135438167) is 1-[(E)-(3,5-dichloro-2-hydroxyphenyl)methylideneamino]-3-hydroxyurea.
What is the SMILES notation for 1-[(E)-(3,5-dichloro-2-hydroxyphenyl)methylideneamino]-3-hydroxyurea?
The canonical SMILES for 1-[(E)-(3,5-dichloro-2-hydroxyphenyl)methylideneamino]-3-hydroxyurea is O=C(NO)N/N=C/c1cc(Cl)cc(Cl)c1O.
What is the InChIKey of 1-[(E)-(3,5-dichloro-2-hydroxyphenyl)methylideneamino]-3-hydroxyurea?
The InChIKey is MKSXBJJBRMGIJI-QDEBKDIKSA-N. The full InChI is InChI=1S/C8H7Cl2N3O3/c9-5-1-4(7(14)6(10)2-5)3-11-12-8(15)13-16/h1-3,14,16H,(H2,12,13,15)/b11-3+.
What are the key properties of 1-[(E)-(3,5-dichloro-2-hydroxyphenyl)methylideneamino]-3-hydroxyurea?
1-[(E)-(3,5-dichloro-2-hydroxyphenyl)methylideneamino]-3-hydroxyurea has a molecular weight of 264.07 g/mol, XLogP of 1.72, 2 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(E)-(3,5-dichloro-2-hydroxyphenyl)methylideneamino]-3-hydroxyurea is sourced from PubChem (CID 135438167), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).