C32H22N4O3 — CID 135438379
5-(15-phenyl-21,23-dihydroporphyrin-5-yl)benzene-1,2,3-triol (PubChem CID 135438379) has the molecular formula C32H22N4O3 and a molecular weight of 510.55 g/mol. Its IUPAC name is 5-(15-phenyl-21,23-dihydroporphyrin-5-yl)benzene-1,2,3-triol.
| Compound Name | 5-(15-phenyl-21,23-dihydroporphyrin-5-yl)benzene-1,2,3-triol |
|---|---|
| PubChem CID | 135438379 |
| Molecular Formula | C32H22N4O3 |
| Molecular Weight | 510.55 g/mol |
| Exact Mass | 510.17 |
| IUPAC Name | 5-(15-phenyl-21,23-dihydroporphyrin-5-yl)benzene-1,2,3-triol |
| SMILES | Oc1cc(-c2c3nc(cc4ccc([nH]4)c(-c4ccccc4)c4nc(cc5ccc2[nH]5)C=C4)C=C3)cc(O)c1O |
| InChI | InChI=1S/C32H22N4O3/c37-28-14-19(15-29(38)32(28)39)31-26-12-8-22(35-26)16-20-6-10-24(33-20)30(18-4-2-1-3-5-18)25-11-7-21(34-25)17-23-9-13-27(31)36-23/h1-17,33,36-39H/b20-16-,21-17-,22-16-,23-17-,30-24-,30-25-,31-26-,31-27- |
| InChIKey | SAELLXWOWUHJMY-UJVCHENRSA-N |
| XLogP | 7.11 |
| TPSA | 118.05 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.55 |
| LogP ≤ 5 | 7.11 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|