C36H30N4O4 — CID 135438406
5-(4-methoxyphenyl)-15-(3,4,5-trimethoxyphenyl)-21,23-dihydroporphyrin (PubChem CID 135438406) has the molecular formula C36H30N4O4 and a molecular weight of 582.66 g/mol. Its IUPAC name is 5-(4-methoxyphenyl)-15-(3,4,5-trimethoxyphenyl)-21,23-dihydroporphyrin.
| Compound Name | 5-(4-methoxyphenyl)-15-(3,4,5-trimethoxyphenyl)-21,23-dihydroporphyrin |
|---|---|
| PubChem CID | 135438406 |
| Molecular Formula | C36H30N4O4 |
| Molecular Weight | 582.66 g/mol |
| Exact Mass | 582.23 |
| IUPAC Name | 5-(4-methoxyphenyl)-15-(3,4,5-trimethoxyphenyl)-21,23-dihydroporphyrin |
| SMILES | COc1ccc(-c2c3nc(cc4ccc([nH]4)c(-c4cc(OC)c(OC)c(OC)c4)c4nc(cc5ccc2[nH]5)C=C4)C=C3)cc1 |
| InChI | InChI=1S/C36H30N4O4/c1-41-27-11-5-21(6-12-27)34-28-13-7-23(37-28)19-25-9-15-30(39-25)35(22-17-32(42-2)36(44-4)33(18-22)43-3)31-16-10-26(40-31)20-24-8-14-29(34)38-24/h5-20,37,40H,1-4H3/b23-19-,24-20-,25-19-,26-20-,34-28-,34-29-,35-30-,35-31- |
| InChIKey | CZNHMFIHXQYROI-ZCUIBMQTSA-N |
| XLogP | 8.02 |
| TPSA | 94.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.66 |
| LogP ≤ 5 | 8.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |