About bis[3-[(3,5-diamino-1H-pyrazol-4-yl)diazenyl]phenyl]methanone
bis[3-[(3,5-diamino-1H-pyrazol-4-yl)diazenyl]phenyl]methanone (PubChem CID 135438535) has the molecular formula C19H18N12O
and a molecular weight of 430.44 g/mol. Its IUPAC name is bis[3-[(3,5-diamino-1H-pyrazol-4-yl)diazenyl]phenyl]methanone.
Molecular Properties
| Compound Name | bis[3-[(3,5-diamino-1H-pyrazol-4-yl)diazenyl]phenyl]methanone |
| PubChem CID | 135438535 |
| Molecular Formula | C19H18N12O |
| Molecular Weight | 430.44 g/mol |
| Exact Mass | 430.17 |
| IUPAC Name | bis[3-[(3,5-diamino-1H-pyrazol-4-yl)diazenyl]phenyl]methanone |
| SMILES | Nc1n[nH]c(N)c1/N=N/c1cccc(C(=O)c2cccc(/N=N/c3c(N)n[nH]c3N)c2)c1 |
| InChI | InChI=1S/C19H18N12O/c20-16-13(17(21)29-28-16)26-24-11-5-1-3-9(7-11)15(32)10-4-2-6-12(8-10)25-27-14-18(22)30-31-19(14)23/h1-8H,(H5,20,21,28,29)(H5,22,23,30,31)/b26-24+,27-25+ |
| InChIKey | HARVHIGMYCFLOA-OWUYFMIJSA-N |
| XLogP | 3.52 |
| TPSA | 227.95 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 430.44 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|
Analyze bis[3-[(3,5-diamino-1H-pyrazol-4-yl)diazenyl]phenyl]methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis[3-[(3,5-diamino-1H-pyrazol-4-yl)diazenyl]phenyl]methanone?
The IUPAC name of bis[3-[(3,5-diamino-1H-pyrazol-4-yl)diazenyl]phenyl]methanone (CID 135438535) is bis[3-[(3,5-diamino-1H-pyrazol-4-yl)diazenyl]phenyl]methanone.
What is the SMILES notation for bis[3-[(3,5-diamino-1H-pyrazol-4-yl)diazenyl]phenyl]methanone?
The canonical SMILES for bis[3-[(3,5-diamino-1H-pyrazol-4-yl)diazenyl]phenyl]methanone is Nc1n[nH]c(N)c1/N=N/c1cccc(C(=O)c2cccc(/N=N/c3c(N)n[nH]c3N)c2)c1.
What is the InChIKey of bis[3-[(3,5-diamino-1H-pyrazol-4-yl)diazenyl]phenyl]methanone?
The InChIKey is HARVHIGMYCFLOA-OWUYFMIJSA-N. The full InChI is InChI=1S/C19H18N12O/c20-16-13(17(21)29-28-16)26-24-11-5-1-3-9(7-11)15(32)10-4-2-6-12(8-10)25-27-14-18(22)30-31-19(14)23/h1-8H,(H5,20,21,28,29)(H5,22,23,30,31)/b26-24+,27-25+.
What are the key properties of bis[3-[(3,5-diamino-1H-pyrazol-4-yl)diazenyl]phenyl]methanone?
bis[3-[(3,5-diamino-1H-pyrazol-4-yl)diazenyl]phenyl]methanone has a molecular weight of 430.44 g/mol, XLogP of 3.52, 6 rotatable bonds, 6 hydrogen bond donors, and 11 hydrogen bond acceptors.
Where does this data come from?
All data for bis[3-[(3,5-diamino-1H-pyrazol-4-yl)diazenyl]phenyl]methanone is sourced from PubChem (CID 135438535), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).