C16H18BrNO2 — CID 135438883
2-[N-(4-bromophenyl)-C-methylcarbonimidoyl]-3-hydroxy-5,5-dimethylcyclohex-2-en-1-one (PubChem CID 135438883) has the molecular formula C16H18BrNO2 and a molecular weight of 336.23 g/mol. Its IUPAC name is 2-[N-(4-bromophenyl)-C-methylcarbonimidoyl]-3-hydroxy-5,5-dimethylcyclohex-2-en-1-one.
| Compound Name | 2-[N-(4-bromophenyl)-C-methylcarbonimidoyl]-3-hydroxy-5,5-dimethylcyclohex-2-en-1-one |
|---|---|
| PubChem CID | 135438883 |
| Molecular Formula | C16H18BrNO2 |
| Molecular Weight | 336.23 g/mol |
| Exact Mass | 335.05 |
| IUPAC Name | 2-[N-(4-bromophenyl)-C-methylcarbonimidoyl]-3-hydroxy-5,5-dimethylcyclohex-2-en-1-one |
| SMILES | C/C(=N\c1ccc(Br)cc1)C1=C(O)CC(C)(C)CC1=O |
| InChI | InChI=1S/C16H18BrNO2/c1-10(18-12-6-4-11(17)5-7-12)15-13(19)8-16(2,3)9-14(15)20/h4-7,19H,8-9H2,1-3H3/b18-10+ |
| InChIKey | SVJXZDSSHLIKLD-VCHYOVAHSA-N |
| XLogP | 4.74 |
| TPSA | 49.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.23 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|