C36H44N2O4 — CID 135439412
2-[hydroxy(phenyl)methylidene]-3-[6-[[2-[hydroxy(phenyl)methylidene]-5,5-dimethyl-3-oxocyclohexylidene]amino]hexylimino]-5,5-dimethylcyclohexan-1-one (PubChem CID 135439412) has the molecular formula C36H44N2O4 and a molecular weight of 568.76 g/mol. Its IUPAC name is 2-[hydroxy(phenyl)methylidene]-3-[6-[[2-[hydroxy(phenyl)methylidene]-5,5-dimethyl-3-oxocyclohexylidene]amino]hexylimino]-5,5-dimethylcyclohexan-1-one.
| Compound Name | 2-[hydroxy(phenyl)methylidene]-3-[6-[[2-[hydroxy(phenyl)methylidene]-5,5-dimethyl-3-oxocyclohexylidene]amino]hexylimino]-5,5-dimethylcyclohexan-1-one |
|---|---|
| PubChem CID | 135439412 |
| Molecular Formula | C36H44N2O4 |
| Molecular Weight | 568.76 g/mol |
| Exact Mass | 568.33 |
| IUPAC Name | 2-[hydroxy(phenyl)methylidene]-3-[6-[[2-[hydroxy(phenyl)methylidene]-5,5-dimethyl-3-oxocyclohexylidene]amino]hexylimino]-5,5-dimethylcyclohexan-1-one |
| SMILES | CC1(C)CC(=O)C(=C(O)c2ccccc2)/C(=N/CCCCCC/N=C2\CC(C)(C)CC(=O)C2=C(O)c2ccccc2)C1 |
| InChI | InChI=1S/C36H44N2O4/c1-35(2)21-27(31(29(39)23-35)33(41)25-15-9-7-10-16-25)37-19-13-5-6-14-20-38-28-22-36(3,4)24-30(40)32(28)34(42)26-17-11-8-12-18-26/h7-12,15-18,41-42H,5-6,13-14,19-24H2,1-4H3/b33-31?,34-32?,37-27+,38-28+ |
| InChIKey | IHPNTQJDJCXRDO-WYIJCFAFSA-N |
| XLogP | 8.15 |
| TPSA | 99.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.76 |
| LogP ≤ 5 | 8.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|