About [(3R)-4,4-dimethyl-2-oxooxolan-3-yl] 2-diazo-3-oxohept-6-enoate
[(3R)-4,4-dimethyl-2-oxooxolan-3-yl] 2-diazo-3-oxohept-6-enoate (PubChem CID 135439481) has the molecular formula C13H16N2O5
and a molecular weight of 280.28 g/mol. Its IUPAC name is [(3R)-4,4-dimethyl-2-oxooxolan-3-yl] 2-diazo-3-oxohept-6-enoate.
Molecular Properties
| Compound Name | [(3R)-4,4-dimethyl-2-oxooxolan-3-yl] 2-diazo-3-oxohept-6-enoate |
| PubChem CID | 135439481 |
| Molecular Formula | C13H16N2O5 |
| Molecular Weight | 280.28 g/mol |
| Exact Mass | 280.11 |
| IUPAC Name | [(3R)-4,4-dimethyl-2-oxooxolan-3-yl] 2-diazo-3-oxohept-6-enoate |
| SMILES | C=CCCC(=O)C(=[N+]=[N-])C(=O)O[C@H]1C(=O)OCC1(C)C |
| InChI | InChI=1S/C13H16N2O5/c1-4-5-6-8(16)9(15-14)11(17)20-10-12(18)19-7-13(10,2)3/h4,10H,1,5-7H2,2-3H3/t10-/m0/s1 |
| InChIKey | DHVKUAQUBRDGGE-JTQLQIEISA-N |
| XLogP | 0.69 |
| TPSA | 106.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.28 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze [(3R)-4,4-dimethyl-2-oxooxolan-3-yl] 2-diazo-3-oxohept-6-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3R)-4,4-dimethyl-2-oxooxolan-3-yl] 2-diazo-3-oxohept-6-enoate?
The IUPAC name of [(3R)-4,4-dimethyl-2-oxooxolan-3-yl] 2-diazo-3-oxohept-6-enoate (CID 135439481) is [(3R)-4,4-dimethyl-2-oxooxolan-3-yl] 2-diazo-3-oxohept-6-enoate.
What is the SMILES notation for [(3R)-4,4-dimethyl-2-oxooxolan-3-yl] 2-diazo-3-oxohept-6-enoate?
The canonical SMILES for [(3R)-4,4-dimethyl-2-oxooxolan-3-yl] 2-diazo-3-oxohept-6-enoate is C=CCCC(=O)C(=[N+]=[N-])C(=O)O[C@H]1C(=O)OCC1(C)C.
What is the InChIKey of [(3R)-4,4-dimethyl-2-oxooxolan-3-yl] 2-diazo-3-oxohept-6-enoate?
The InChIKey is DHVKUAQUBRDGGE-JTQLQIEISA-N. The full InChI is InChI=1S/C13H16N2O5/c1-4-5-6-8(16)9(15-14)11(17)20-10-12(18)19-7-13(10,2)3/h4,10H,1,5-7H2,2-3H3/t10-/m0/s1.
What are the key properties of [(3R)-4,4-dimethyl-2-oxooxolan-3-yl] 2-diazo-3-oxohept-6-enoate?
[(3R)-4,4-dimethyl-2-oxooxolan-3-yl] 2-diazo-3-oxohept-6-enoate has a molecular weight of 280.28 g/mol, XLogP of 0.69, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [(3R)-4,4-dimethyl-2-oxooxolan-3-yl] 2-diazo-3-oxohept-6-enoate is sourced from PubChem (CID 135439481), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).