C12H7N7O3 — CID 135439499
6-(3-oxo-2,5-dihydro-[1,2,4]triazino[5,6-b]indol-6-yl)-2H-1,2,4-triazine-3,5-dione (PubChem CID 135439499) has the molecular formula C12H7N7O3 and a molecular weight of 297.23 g/mol. Its IUPAC name is 6-(3-oxo-2,5-dihydro-[1,2,4]triazino[5,6-b]indol-6-yl)-2H-1,2,4-triazine-3,5-dione.
| Compound Name | 6-(3-oxo-2,5-dihydro-[1,2,4]triazino[5,6-b]indol-6-yl)-2H-1,2,4-triazine-3,5-dione |
|---|---|
| PubChem CID | 135439499 |
| Molecular Formula | C12H7N7O3 |
| Molecular Weight | 297.23 g/mol |
| Exact Mass | 297.06 |
| IUPAC Name | 6-(3-oxo-2,5-dihydro-[1,2,4]triazino[5,6-b]indol-6-yl)-2H-1,2,4-triazine-3,5-dione |
| SMILES | O=c1nc2[nH]c3c(-c4n[nH]c(=O)[nH]c4=O)cccc3c2n[nH]1 |
| InChI | InChI=1S/C12H7N7O3/c20-10-8(17-19-12(22)15-10)5-3-1-2-4-6(5)13-9-7(4)16-18-11(21)14-9/h1-3H,(H2,13,14,18,21)(H2,15,19,20,22) |
| InChIKey | NDEFUAKASPWEGP-UHFFFAOYSA-N |
| XLogP | -0.76 |
| TPSA | 153.04 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.23 |
| LogP ≤ 5 | -0.76 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |