About N-(pyridin-3-ylmethyl)-1,4-dihydro-3,1-benzothiazin-2-imine
N-(pyridin-3-ylmethyl)-1,4-dihydro-3,1-benzothiazin-2-imine (PubChem CID 135439654) has the molecular formula C14H13N3S
and a molecular weight of 255.35 g/mol. Its IUPAC name is N-(pyridin-3-ylmethyl)-1,4-dihydro-3,1-benzothiazin-2-imine.
Molecular Properties
| Compound Name | N-(pyridin-3-ylmethyl)-1,4-dihydro-3,1-benzothiazin-2-imine |
| PubChem CID | 135439654 |
| Molecular Formula | C14H13N3S |
| Molecular Weight | 255.35 g/mol |
| Exact Mass | 255.08 |
| IUPAC Name | N-(pyridin-3-ylmethyl)-1,4-dihydro-3,1-benzothiazin-2-imine |
| SMILES | c1cncc(C/N=C2/Nc3ccccc3CS2)c1 |
| InChI | InChI=1S/C14H13N3S/c1-2-6-13-12(5-1)10-18-14(17-13)16-9-11-4-3-7-15-8-11/h1-8H,9-10H2,(H,16,17) |
| InChIKey | HDIOKFQLUKIROG-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 37.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.35 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze N-(pyridin-3-ylmethyl)-1,4-dihydro-3,1-benzothiazin-2-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(pyridin-3-ylmethyl)-1,4-dihydro-3,1-benzothiazin-2-imine?
The IUPAC name of N-(pyridin-3-ylmethyl)-1,4-dihydro-3,1-benzothiazin-2-imine (CID 135439654) is N-(pyridin-3-ylmethyl)-1,4-dihydro-3,1-benzothiazin-2-imine.
What is the SMILES notation for N-(pyridin-3-ylmethyl)-1,4-dihydro-3,1-benzothiazin-2-imine?
The canonical SMILES for N-(pyridin-3-ylmethyl)-1,4-dihydro-3,1-benzothiazin-2-imine is c1cncc(C/N=C2/Nc3ccccc3CS2)c1.
What is the InChIKey of N-(pyridin-3-ylmethyl)-1,4-dihydro-3,1-benzothiazin-2-imine?
The InChIKey is HDIOKFQLUKIROG-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H13N3S/c1-2-6-13-12(5-1)10-18-14(17-13)16-9-11-4-3-7-15-8-11/h1-8H,9-10H2,(H,16,17).
What are the key properties of N-(pyridin-3-ylmethyl)-1,4-dihydro-3,1-benzothiazin-2-imine?
N-(pyridin-3-ylmethyl)-1,4-dihydro-3,1-benzothiazin-2-imine has a molecular weight of 255.35 g/mol, XLogP of 3.30, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(pyridin-3-ylmethyl)-1,4-dihydro-3,1-benzothiazin-2-imine is sourced from PubChem (CID 135439654), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).